CAS 200698-05-1: 9-benzyl-9H-carbazole-3,6-dicarbaldehyde
Description:9-Benzyl-9H-carbazole-3,6-dicarbaldehyde is an organic compound characterized by its complex structure, which includes a carbazole core substituted with benzyl and aldehyde groups. This compound typically exhibits properties associated with both aromatic and aldehyde functionalities, such as potential fluorescence and reactivity towards nucleophiles due to the presence of the aldehyde groups. It is likely to be a solid at room temperature, with solubility in organic solvents like dichloromethane or ethanol, but limited solubility in water due to its hydrophobic nature. The presence of the carbazole moiety suggests potential applications in organic electronics, such as in light-emitting diodes or as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity.
Formula:C21H15NO2
InChI:InChI=1/C21H15NO2/c23-13-16-6-8-20-18(10-16)19-11-17(14-24)7-9-21(19)22(20)12-15-4-2-1-3-5-15/h1-11,13-14H,12H2
- Synonyms:
- 9H-carbazole-3,6-dicarboxaldehyde, 9-(phenylmethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 9H-Carbazole-3,6-dicarboxaldehyde, 9-(phenylmethyl)- REF: IN-DA002CWLCAS: 200698-05-1 | 98% | 109.00 €~333.00 € | Wed 16 Apr 25 |
![]() | 9-Benzyl-9H-Carbazole-3,6-Dicarbaldehyde REF: 54-OR1026227CAS: 200698-05-1 | 98% | 82.00 €~1,380.00 € | Thu 17 Apr 25 |
![]() | 9-Benzylcarbazole-3,6-dicarboxaldehyde REF: 3B-B2805CAS: 200698-05-1 | >98.0%(HPLC) | - - - | Discontinued product |
![]() | 9-Benzylcarbazole-3,6-dicarboxaldehyde REF: 3D-FB62352CAS: 200698-05-1 | Min. 95% | - - - | Discontinued product |

9H-Carbazole-3,6-dicarboxaldehyde, 9-(phenylmethyl)-
Ref: IN-DA002CWL
1g | 330.00 € | ||
25mg | 109.00 € | ||
100mg | 112.00 € | ||
250mg | 150.00 € |

Ref: 54-OR1026227
1g | 329.00 € | ||
5g | 1,380.00 € | ||
100mg | 82.00 € | ||
250mg | 135.00 € |

9-Benzylcarbazole-3,6-dicarboxaldehyde
Ref: 3B-B2805
100mg | Discontinued | Request information |

9-Benzylcarbazole-3,6-dicarboxaldehyde
Ref: 3D-FB62352
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |