CAS 200714-52-9

5-Chloro-2-(4-piperidinyl)-1H-indole

Description:

5-Chloro-2-(4-piperidinyl)-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chlorine atom at the 5-position and a piperidine group at the 2-position contributes to its unique properties. This compound is often studied for its potential pharmacological applications, particularly in the field of neuroscience and medicinal chemistry, due to its ability to interact with various biological targets. It may exhibit properties such as acting as a ligand for certain receptors or enzymes, influencing neurotransmitter systems. The piperidine moiety can enhance its solubility and bioavailability, making it a candidate for further research in drug development. As with many chemical substances, safety and handling precautions are essential, as it may pose risks if not managed properly. Overall, 5-Chloro-2-(4-piperidinyl)-1H-indole represents a compound of interest in the exploration of therapeutic agents.

Formula: C₁₃H₁₅ClN₂

InChI: InChI=1S/C13H15ClN2/c14-11-1-2-12-10(7-11)8-13(16-12)9-3-5-15-6-4-9/h1-2,7-9,15-16H,3-6H2

InChI key: InChIKey=LLCORCOHPKCEEK-UHFFFAOYSA-N

SMILES: ClC=1C=C2C=C(NC2=CC1)C3CCNCC3

Synonyms:

• 1H-Indole, 5-chloro-2-(4-piperidinyl)-
• 5-Chloro-2-(4-piperidinyl)-1H-indole

5-Chloro-2-(piperidin-4-yl)-1H-indole

CAS: 200714-52-9

Versatile small molecule scaffold

Formula: C₁₃H₁₅ClN₂

Purity: Min. 95%

Molecular weight: 234.72 g/mol

Ref: 3D-AIA71452