CAS 20073-24-9
:Ethyl 7-oxo-7H-furo[3,2-g][1]benzopyran-6-carboxylate
Description:
Ethyl 7-oxo-7H-furo[3,2-g][1]benzopyran-6-carboxylate, with the CAS number 20073-24-9, is a chemical compound characterized by its complex bicyclic structure that incorporates both furan and benzopyran moieties. This compound typically exhibits a range of functional groups, including a carboxylate ester and a ketone, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. Ethyl 7-oxo-7H-furo[3,2-g][1]benzopyran-6-carboxylate is often studied for its biological activities, including potential antioxidant and anti-inflammatory properties, making it of interest in pharmacological research. The presence of the ethyl ester group enhances its solubility in organic solvents, facilitating its use in various chemical reactions. Additionally, the compound's unique structural features may allow for interactions with biological targets, which is valuable in drug development. Overall, this compound represents a significant interest in the fields of organic chemistry and medicinal chemistry due to its diverse chemical properties and potential therapeutic applications.
Formula:C14H10O5
InChI:InChI=1S/C14H10O5/c1-2-17-13(15)10-6-9-5-8-3-4-18-11(8)7-12(9)19-14(10)16/h3-7H,2H2,1H3
InChI key:InChIKey=CFQAMEDTKHNQTP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC2=C(C=C3C(=C2)C=CO3)OC1=O
Synonyms:- ((6-Hydroxy-5-benzofuranyl)methylene)malonic acid, gamma-lactone, ethyl ester
- 3-CPs
- 3-Carbethoxypsoralen
- 3-Ethoxycarbonylpsoralen
- 7-Oxo-7H-furo(3,2-g)(1)benzopyran-6-carboxylic acid ethyl ester
- 7H-Furo(3,2-g)(1)benzopyran-6-carboxylic acid, 7-oxo-, ethyl ester
- Brn 0278285
- Ethyl 3-psoralencarboxylate
- Ethyl furo[3,2-g]coumarin-3-carboxylate
- ethyl 7-oxo-7H-furo[3,2-g]chromene-6-carboxylate
- Ethyl 7-oxo-7H-furo(3,2-g)(1)benzopyran-6-carboxylate
- Ethyl 7-oxo-7H-furo[3,2-g][1]benzopyran-6-carboxylate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-CPs
CAS:3-CPs (3-Carbethoxypsoralen) is a mouse lung fibrosis serotyped podoplanar polysaccharide that can be used to study airway inflammation and asthma.Formula:C14H10O5Purity:97.58% - 99%Color and Shape:SolidMolecular weight:258.23Ethyl 7-oxo-7H-furo[3,2-g]chromene-6-carboxylate
CAS:Formula:C14H10O5Purity:95%Molecular weight:258.22623-Carbethoxypsoralen
CAS:3-Carbethoxypsoralen is a potent inducer of DNA damage by interacting with the nuclear DNA. It also has a role in the transfer reactions between 8-methoxypsoralen and 3-hydroxypsoralen, which are responsible for the photochemical activity of these compounds. 3-Carbethoxypsoralen has been shown to be genotoxic and mutagenic in both wild-type and mutant strains of Escherichia coli. 3-Carbethoxypsoralen is also an effective inhibitor of protein synthesis, as well as being a potent inducer of biochemical properties including cell death. This drug is used in the treatment of infectious diseases, such as herpes simplex virus type 1 (HSV-1) and varicella zoster virus (VZV).
Formula:C14H10O5Purity:Min. 95%Molecular weight:258.23 g/mol



