CAS 20074-67-3

tetrachloropyridazine

Description:

Tetrachloropyridazine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of four chlorine atoms attached to the pyridazine structure significantly influences its chemical properties, making it a highly chlorinated derivative. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its stability under normal conditions but can be reactive under certain circumstances, particularly in the presence of strong nucleophiles or under extreme conditions. Tetrachloropyridazine is primarily used in agricultural applications, particularly as a herbicide, due to its ability to inhibit specific biochemical pathways in plants. Its environmental persistence and potential toxicity necessitate careful handling and regulation. Additionally, the compound's unique structure allows for various chemical reactions, making it of interest in synthetic organic chemistry. Safety data sheets should be consulted for handling precautions, as chlorinated compounds can pose health risks if not managed properly.

Formula: C₄Cl₄N₂

InChI: InChI=1/C4Cl4N2/c5-1-2(6)4(8)10-9-3(1)7

SMILES: c1(c(c(Cl)nnc1Cl)Cl)Cl

Synonyms:

• Pyridazine, 3,4,5,6-Tetrachloro-
• Pyridazine, tetrachloro-
• Tetrachloropyridazine

Pyridazine, 3,4,5,6-tetrachloro-

CAS: 20074-67-3

Formula: C₄Cl₄N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.8682

Ref: IN-DA002CY9

Tetrachloropyridazine

CAS: 20074-67-3

Tetrachloropyridazine

Purity: 98%

Molecular weight: 217.87g/mol

Ref: 54-OR6953

Perchloropyridazine

CAS: 20074-67-3

Formula: C₄Cl₄N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.86

Ref: 10-F233678

Tetrachloropyridazine

CAS: 20074-67-3

Tetrachloropyridazine is a reactive chlorine atom that is a byproduct of the production of chlorofluorocarbons. It is an intermediate in the synthesis of the pesticide DDT. The molecule is also used as a reagent in organic synthesis and in the synthesis of other compounds such as trifluoroacetic acid, nitro, and diazonium salt. Tetrachloropyridazine has been shown to be cytotoxic against cancer cells. Tetrachloropyridazine reacts with DNA at N7-position on purines, leading to its reactivity with nucleophiles such as amines and alcohols. The reaction mechanism begins with nucleophilic attack on the electron deficient nitrogen atoms, followed by elimination of hydrogen chloride and formation of a stable heterocycle.

Formula: C₄Cl₄N₂

Purity: Min. 95%

Molecular weight: 217.87 g/mol

Ref: 3D-VAA07467