CAS 2007916-56-3

7-Isoquinolinecarboxylic acid, 4-bromo-, methyl ester

Description:

7-Isoquinolinecarboxylic acid, 4-bromo-, methyl ester is an organic compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylic acid functional group that is esterified with a methyl group, indicating it is a methyl ester. The presence of a bromine atom at the 4-position of the isoquinoline ring introduces a halogen substituent, which can influence the compound's reactivity and physical properties. Typically, compounds like this exhibit moderate solubility in organic solvents and may have specific applications in medicinal chemistry or as intermediates in organic synthesis. The molecular structure suggests potential biological activity, as isoquinoline derivatives are often explored for their pharmacological properties. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral data, would be essential for its identification and application in research and industry.

Formula: C₁₁H₈BrNO₂

InChI: InChI=1S/C11H8BrNO2/c1-15-11(14)7-2-3-9-8(4-7)5-13-6-10(9)12/h2-6H,1H3

InChI key: InChIKey=NKPFPFQGYSIGMW-UHFFFAOYSA-N

SMILES: BrC=1C2=C(C=C(C(OC)=O)C=C2)C=NC1

Synonyms:

• Methyl 4-bromoisoquinoline-7-carboxylate
• 7-Isoquinolinecarboxylic acid, 4-bromo-, methyl ester

methyl 4-bromoisoquinoline-7-carboxylate

CAS: 2007916-56-3

Formula: C₁₁H₈BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 266.0907

Ref: IN-DA01FPS6

Methyl 4-bromoisoquinoline-7-carboxylate

CAS: 2007916-56-3

Methyl 4-bromoisoquinoline-7-carboxylate

Purity: 98%

Molecular weight: 266.09g/mol

Ref: 54-OR78999

METHYL 4-BROMOISOQUINOLINE-7-CARBOXYLATE

CAS: 2007916-56-3

Formula: C₁₁H₈BrNO₂

Purity: 98%

Molecular weight: 266.094

Ref: 10-F532572