CAS 2007919-27-7

Pyridine, 2-(bromomethyl)-5-methoxy-, hydrobromide (1:1)

Description:

Pyridine, 2-(bromomethyl)-5-methoxy-, hydrobromide (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromomethyl group at the 2-position and a methoxy group at the 5-position contributes to its reactivity and potential applications in organic synthesis. As a hydrobromide salt, it is typically encountered in a crystalline form and is soluble in polar solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of the bromine atom may impart unique reactivity, allowing for further functionalization in synthetic pathways. Safety precautions should be observed when handling this compound, as halogenated organic compounds can pose health risks. Overall, this substance is significant in various chemical research and industrial applications.

Formula: C₇H₈BrNO·BrH

InChI: InChI=1S/C7H8BrNO.BrH/c1-10-7-3-2-6(4-8)9-5-7;/h2-3,5H,4H2,1H3;1H

InChI key: InChIKey=IBPDGBSBKPHSMS-UHFFFAOYSA-N

SMILES: O(C)C=1C=CC(CBr)=NC1.Br

Synonyms:

• Pyridine, 2-(bromomethyl)-5-methoxy-, hydrobromide (1:1)
• 2-(Bromomethyl)-5-methoxypyridine hydrobromide

2-(Bromomethyl)-5-methoxypyridine hydrobromide

CAS: 2007919-27-7

Formula: C₇H₉Br₂NO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 282.963

Ref: 10-F512446