CymitQuimica logo

CAS 2007919-47-1

:

Methanesulfonamide, N-methyl-N-(3R)-3-piperidinyl-, hydrochloride (1:1)

Description:
Methanesulfonamide, N-methyl-N-(3R)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a piperidine ring, a six-membered nitrogen-containing heterocycle, which contributes to its pharmacological activity. The presence of the N-methyl group enhances its lipophilicity, potentially improving its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for pharmaceutical formulations. The compound's stereochemistry, indicated by the (3R) designation, suggests specific spatial arrangements that can influence its biological interactions and efficacy. Methanesulfonamide derivatives are often investigated for their potential therapeutic applications, including roles in treating various diseases. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and utility of sulfonamide derivatives in medicinal chemistry.
Formula:C7H16N2O2S·ClH
InChI:InChI=1S/C7H16N2O2S.ClH/c1-9(12(2,10)11)7-4-3-5-8-6-7;/h7-8H,3-6H2,1-2H3;1H/t7-;/m1./s1
InChI key:InChIKey=KMRXTSVFRZNPJN-OGFXRTJISA-N
SMILES:N(S(C)(=O)=O)(C)[C@@H]1CCCNC1.Cl
Synonyms:
  • Methanesulfonamide, N-methyl-N-(3R)-3-piperidinyl-, hydrochloride (1:1)
Found 2 products.