CAS 2007920-63-8

1H-Indole-3-ethanamine, 5-(methylsulfonyl)-, hydrochloride (1:1)

Description:

1H-Indole-3-ethanamine, 5-(methylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features an ethylamine side chain at the 3-position and a methylsulfonyl group at the 5-position of the indole ring, contributing to its unique chemical properties. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in biological and pharmaceutical contexts. The presence of the methylsulfonyl group may impart specific biological activities, potentially influencing its interaction with biological targets. As with many indole derivatives, this compound may exhibit a range of pharmacological effects, including neuroactivity, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its classification and potential biological effects.

Formula: C₁₁H₁₄N₂O₂S·ClH

InChI: InChI=1S/C11H14N2O2S.ClH/c1-16(14,15)9-2-3-11-10(6-9)8(4-5-12)7-13-11;/h2-3,6-7,13H,4-5,12H2,1H3;1H

InChI key: InChIKey=ABNZKVVQSVWXOF-UHFFFAOYSA-N

SMILES: C(CN)C=1C=2C(NC1)=CC=C(S(C)(=O)=O)C2.Cl

Synonyms:

• 1H-Indole-3-ethanamine, 5-(methylsulfonyl)-, hydrochloride (1:1)

2-(5-(METHYLSULFONYL)-1H-INDOL-3-YL)ETHANAMINE HYDROCHLORIDE

CAS: 2007920-63-8

Formula: C₁₁H₁₅ClN₂O₂S

Purity: 95.0%

Molecular weight: 274.76

Ref: 10-F474159