
CAS 2007924-98-1
:2-Pyrrolidinemethanamine, N,1-dimethyl-, hydrochloride (1:1)
Description:
2-Pyrrolidinemethanamine, N,1-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional groups and a pyrrolidine ring structure. This substance is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in pharmaceuticals and organic synthesis. The presence of the dimethyl group contributes to its basicity and reactivity, allowing it to participate in a range of chemical reactions, including nucleophilic substitutions and coupling reactions. As a hydrochloride salt, it exhibits properties typical of amines, such as the ability to form hydrogen bonds, which can influence its physical properties like melting point and boiling point. Additionally, this compound may have implications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H16N2·ClH
InChI:InChI=1S/C7H16N2.ClH/c1-8-6-7-4-3-5-9(7)2;/h7-8H,3-6H2,1-2H3;1H
InChI key:InChIKey=XVSMHWLSPXMMIG-UHFFFAOYSA-N
SMILES:C(NC)C1N(C)CCC1.Cl
Synonyms:- 2-Pyrrolidinemethanamine, N,1-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl[(1-methylpyrrolidin-2-yl)methyl]amine hydrochloride
CAS:Formula:C7H17ClN2Molecular weight:164.6763
