CymitQuimica logo

CAS 2008-62-0

:

1-isocyano-2-methoxy-4-nitrobenzene

Description:
1-Isocyano-2-methoxy-4-nitrobenzene, with the CAS number 2008-62-0, is an organic compound characterized by its unique functional groups. It features an isocyanide group (-N≡C) attached to a benzene ring that also contains a methoxy group (-OCH3) and a nitro group (-NO2) at specific positions. This compound is typically a yellow to brown solid, exhibiting moderate solubility in organic solvents. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and stability. The isocyanide functional group is known for its versatility in organic synthesis, often participating in various reactions such as nucleophilic additions and cycloadditions. Additionally, the methoxy group can enhance the compound's lipophilicity and affect its interaction with biological systems. Overall, 1-isocyano-2-methoxy-4-nitrobenzene is of interest in synthetic organic chemistry and may have applications in materials science and medicinal chemistry due to its distinctive structural features.
Formula:C8H6N2O3
InChI:InChI=1/C8H6N2O3/c1-9-7-4-3-6(10(11)12)5-8(7)13-2/h3-5H,2H3
SMILES:[C-]#[N+]c1ccc(cc1OC)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.