CAS 200801-70-3

2-{3-[bis(1-methylethyl)amino]-1-phenylpropyl}-4-(hydroxymethyl)phenol

Description:

The chemical substance known as 2-{3-[bis(1-methylethyl)amino]-1-phenylpropyl}-4-(hydroxymethyl)phenol, with the CAS number 200801-70-3, is a complex organic compound characterized by its multi-functional structure. It features a phenolic group, which contributes to its potential as an antioxidant or a stabilizer in various applications. The presence of a hydroxymethyl group enhances its reactivity and solubility in polar solvents. Additionally, the compound contains a bis(1-methylethyl)amino moiety, indicating that it has significant steric hindrance, which may influence its biological activity and interaction with other molecules. This structure suggests potential applications in pharmaceuticals or as a chemical intermediate. The compound's properties, such as solubility, melting point, and stability, would depend on its specific molecular interactions and the environment in which it is used. Overall, this substance exemplifies the complexity and versatility of organic compounds in chemical synthesis and application.

Formula: C₂₂H₃₁NO₂

InChI: InChI=1/C22H31NO2/c1-16(2)23(17(3)4)13-12-20(19-8-6-5-7-9-19)21-14-18(15-24)10-11-22(21)25/h5-11,14,16-17,20,24-25H,12-13,15H2,1-4H3

SMILES: CC(C)N(CCC(c1ccccc1)c1cc(ccc1O)CO)C(C)C

Benzenemethanol, 3-[3-[bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxy-

CAS: 200801-70-3

Formula: C₂₂H₃₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 341.4870

Ref: IN-DA002D0R

(Rac)-5-Hydroxymethyl Tolterodine

CAS: 200801-70-3

(Rac)-5-Hydroxymethyl Tolterodine

Purity: 98%

Molecular weight: 341.5g/mol

Ref: 54-OR1031959

2-(3-(DIISOPROPYLAMINO)-1-PHENYLPROPYL)-4-(HYDROXYMETHYL)PHENOL

CAS: 200801-70-3

Purity: 98%

Molecular weight: 341.4949951

Ref: 10-F798957

rac 5-Hydroxymethyl Tolterodine, 90% by HPLC

Controlled Product

CAS: 200801-70-3

Formula: C₂₂H₃₁NO₂

Purity: 90% by HPLC

Color and Shape: Neat

Molecular weight: 341.49

Ref: TR-H948365

rac 5-Hydroxymethyl Tolterodine by HPLC

CAS: 200801-70-3

Racemic 5-Hydroxymethyl Tolterodine is an industrial chemical that can be used in the production of fesoterodine. It is a racemic form, which means it has two forms that are mirror images of each other, and cannot be separated. This chemical is produced by the reaction of tolterodine with acetone and isobutyric acid in an organic solvent. The yields are dependent on the type of reagents used, such as deacyl and intermediates. Racemic 5-Hydroxymethyl Tolterodine crystallizes as a white powder and has a melting point of 104°C. It can be chiral, meaning it has two different forms that are not superimposable on one another. Racemic 5-Hydroxymethyl Tolterodine utilises isobutyryl chloride as an intermediate in its synthesis process.br>br>

Formula: C₂₂H₃₁NO₂

Purity: Min. 95%

Molecular weight: 341.49 g/mol

Ref: 3D-AIA80170

Fesoterodine Impurity A

CAS: 200801-70-3

Formula: C₂₂H₃₁NO₂

Molecular weight: 341.5

Ref: ST-EA-CP-F17003