CAS 20083-34-5
:Pentafluorophenyltriethoxysilane
Description:
Pentafluorophenyltriethoxysilane, with the CAS number 20083-34-5, is an organosilicon compound characterized by the presence of a pentafluorophenyl group and three ethoxy groups attached to a silicon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its high reactivity due to the presence of the silicon-oxygen bond and the electronegative fluorine atoms. The pentafluorophenyl group imparts unique electronic properties, making it useful in various applications, including surface modification, adhesion promotion, and as a precursor in the synthesis of fluorinated materials. Its ethoxy groups can undergo hydrolysis and condensation reactions, allowing for the formation of siloxane networks. Additionally, the compound exhibits low volatility and high thermal stability, which are advantageous for certain industrial applications. Safety precautions should be taken when handling this substance, as it may be harmful if inhaled or ingested, and can cause skin and eye irritation.
Formula:C12H15F5O3Si
InChI:InChI=1/C12H15F5O3Si/c1-4-18-21(19-5-2,20-6-3)12-10(16)8(14)7(13)9(15)11(12)17/h4-6H2,1-3H3
SMILES:CCO[Si](c1c(c(c(c(c1F)F)F)F)F)(OCC)OCC
Synonyms:- Pentafluorophenyl)Triethoxysilane
- Triethoxy(Pentafluorophenyl)Silane
- (Pentafluorophenyl)tris(ethoxy)silane
- [Tris(ethoxy)silyl]perfluorobenzene
- triethoxy-(1,2,3,4,5,6-hexafluoro-1-cyclohexa-2,4-dienyl)silane
- (Triethoxysilyl)pentafluorobenzene
- Benzene, 1,2,3,4,5-pentafluoro-6-(triethoxysilyl)-
- triethoxy(perfluorophenyl)silane
- riethoxy-(2,3,4,5,6-pentafluorophenyl)silane
- (Pentafluorophenyl)triethoxysilane 97%
- AKOS MSC-0208
- (Triethoxysilyl)perfluorobenzene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Triethoxy(pentafluorophenyl)silane
CAS:Formula:C12H15F5O3SiPurity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:330.33Benzene, 1,2,3,4,5-pentafluoro-6-(triethoxysilyl)-
CAS:Formula:C12H15F5O3SiPurity:95%Color and Shape:LiquidMolecular weight:330.3232(Triethoxysilyl)pentafluorobenzene
CAS:(Triethoxysilyl)pentafluorobenzeneFormula:C12H15F5O3SiPurity:98%Color and Shape: colourless liquidMolecular weight:330.32g/molPentafluorophenyltriethoxysilane
CAS:S12859 - Pentafluorophenyltriethoxysilane
Formula:C12H15F5O3SiPurity:97%Color and Shape:Liquid, ClearMolecular weight:330.326PENTAFLUOROPHENYLTRIETHOXYSILANE
CAS:Arylsilane Cross-Coupling Agent
The cross-coupling reaction is a highly useful methodology for the formation of carbon-carbon bonds. It involves two reagents, with one typically being a suitable organometallic reagent - the nucleophile - and the other a suitable organic substrate, normally an unsaturated halide, tosylate or similar - the electrophile.
Pentafluorophenyltriethoxysilane; Triethoxysilylperfluorobenzene
Forms hydrogen-free silicone resins useful in optical coatingsUseful for the preparation of pentafluorophenyl derivativesExtensive review of silicon based cross-coupling agents: Denmark, S. E. et al. "Organic Reactions, Volume 75" Denmark, S. E. ed., John Wiley and Sons, 233, 2011Formula:C12H15F5O3SiPurity:97%Color and Shape:Straw LiquidMolecular weight:330.33




