CAS 20083-38-9
:trichloro(pentafluorophenyl)silane
Description:
Trichloro(pentafluorophenyl)silane, with the CAS number 20083-38-9, is an organosilicon compound characterized by the presence of a silicon atom bonded to three chlorine atoms and one pentafluorophenyl group. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly in hydrolysis reactions, where it can release hydrochloric acid upon contact with moisture. The pentafluorophenyl group imparts significant electronegativity and hydrophobic characteristics, making the compound useful in various applications, including as a silane coupling agent in polymer and material science. Its high fluorine content contributes to its thermal stability and resistance to chemical degradation. However, due to its reactivity and potential toxicity, handling trichloro(pentafluorophenyl)silane requires appropriate safety precautions, including the use of personal protective equipment and working in a well-ventilated area or fume hood. Overall, this compound is valuable in specialized chemical synthesis and surface modification processes.
Formula:C6Cl3F5Si
InChI:InChI=1/C6Cl3F5Si/c7-15(8,9)6-4(13)2(11)1(10)3(12)5(6)14
SMILES:c1(c(c(c(c(c1F)F)[Si](Cl)(Cl)Cl)F)F)F
Synonyms:- Benzene, 1,2,3,4,5-Pentafluoro-6-(Trichlorosilyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Trichlorosilyl)pentafluorobenzene
CAS:(Trichlorosilyl)pentafluorobenzeneFormula:C6Cl3F5SiPurity:≥95%Color and Shape: clear liquidMolecular weight:301.50g/molPentafluorophenyltrichlorosilane
CAS:Controlled ProductFormula:C6Cl3F5SiColor and Shape:NeatMolecular weight:301.501Trichloro(Pentafluorophenyl)Silane
CAS:Trichloro(Pentafluorophenyl)Silane is a silicon compound that has been used as a coating for glass, plastics, and other materials to make them hydrophobic. It is also used in the production of microlenses and waveguides. Trichloro(Pentafluorophenyl)Silane can be used as an insulator in semiconductor devices and has a constant dielectric constant of 3.1 at 1GHz. This material can be hydrolyzed by water to form trichlorosilane, which is useful for the production of organosilicon compounds.Formula:C6Cl3F5SiPurity:Min. 95%Molecular weight:301.5 g/mol



