CAS 20086-06-0

Diosbulbin B

Description:

Diosbulbin B is a natural compound classified as a sesquiterpenoid, primarily derived from the plant Dioscorea bulbifera, commonly known as air potato. This compound exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. Diosbulbin B has garnered attention in pharmacological research due to its potential anti-inflammatory, anti-cancer, and anti-microbial properties. Its mechanism of action may involve the modulation of various signaling pathways, although specific details are still under investigation. The compound is typically studied in the context of traditional medicine and modern therapeutic applications, highlighting its significance in both ethnopharmacology and drug discovery. Additionally, Diosbulbin B's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in experimental settings. Overall, Diosbulbin B represents a promising area of study within natural product chemistry and medicinal research.

Formula: C₁₉H₂₀O₆

InChI: InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3

InChI key: InChIKey=QEANLIISUSNNDX-UHFFFAOYSA-N

SMILES: CC12C3(CC(OC3=O)C4C1CC5CC4C(=O)O5)OC(C2)C=6C=COC6

Synonyms:

• (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-2-(3-Furanyl)octahydro-11b-methyl-4H-3a,6:7,10-dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione
• 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, (2R,3aS,6S,6aS,7R,10R,11aR,11bS)-
• 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, [2R-(2α,3aβ,6β,6aβ,7β,10β,11aα,11bβ)]-
• Diosbulbin B

Diosbulbin B

CAS: 20086-06-0

Formula: C₁₉H₂₀O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 344.3585

Ref: IN-DA00C1JX

Diosbulbin B

CAS: 20086-06-0

Diosbulbin B

Purity: ≥98%

Molecular weight: 344.36g/mol

Ref: 54-BUP18042

Diosbulbin B

CAS: 20086-06-0

Diosbulbin B

Purity: 97%

Molecular weight: 344.36g/mol

Ref: 54-OR1024235

Diosbulbin B

CAS: 20086-06-0

Formula: C₁₉H₂₀O₆

Molecular weight: 344.36

Ref: 7W-GY9261

Diosbulbin B

CAS: 20086-06-0

Diosbulbin B has potential anti-tumor effects which may be related to influencing the immune system for the first time, it also exhibits potential hepatotoxicity.

Formula: C₁₉H₂₀O₆

Purity: 95%~99%

Molecular weight: 344.363

Ref: BP-BP0502

Diosbulbin B

CAS: 20086-06-0

Diosbulbin B is hepatotoxic and may have anti-tumor properties via immune system modulation.

Formula: C₁₉H₂₀O₆

Purity: 98.92% - 99.84%

Color and Shape: Solid

Molecular weight: 344.36

Ref: TM-T4S0790

Diosbulbin B

CAS: 20086-06-0

Diosbulbin B is a naturally occurring sesquiterpene lactone, which is derived primarily from the plant Dioscorea bulbifera, commonly known as "air potato" or "bitter yam." As a bioactive compound, Diosbulbin B demonstrates a mode of action that involves the induction of cytotoxicity in malignant cells, primarily through the disruption of microtubule dynamics, leading to cell cycle arrest and apoptosis.

Formula: C₁₉H₂₀O₆

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 344.36 g/mol

Ref: 3D-FD73894