
CAS 20086-07-1
:(2R,3aS,6S,6aS,7R,9R,10aR,10bS)-2-(3-Furanyl)decahydro-9-hydroxy-10b-methyl-4-oxo-4H-3a,6-methanofuro[2,3-d][2]benzoxepin-7-carboxylic acid
Description:
The chemical substance with the name "(2R,3aS,6S,6aS,7R,9R,10aR,10bS)-2-(3-Furanyl)decahydro-9-hydroxy-10b-methyl-4-oxo-4H-3a,6-methanofuro[2,3-d][2]benzoxepin-7-carboxylic acid" and CAS number "20086-07-1" is a complex organic compound characterized by its multi-ring structure, which includes a furan moiety and a benzoxepin framework. This compound features multiple stereocenters, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and chemical reactivity. The presence of a hydroxyl group and a carboxylic acid functional group suggests potential for hydrogen bonding and reactivity in various chemical environments. Additionally, the oxo group contributes to the compound's overall polarity and may play a role in its interaction with biological targets. Such compounds are often studied for their potential pharmacological properties, including anti-inflammatory or anticancer activities, due to their structural complexity and ability to interact with biological systems.
Formula:C19H22O7
InChI:InChI=1S/C19H22O7/c1-18-6-13(9-2-3-24-8-9)26-19(18)7-14(25-17(19)23)15-11(16(21)22)4-10(20)5-12(15)18/h2-3,8,10-15,20H,4-7H2,1H3,(H,21,22)
InChI key:InChIKey=UYALWPKCIMKALF-UHFFFAOYSA-N
SMILES:CC12C3(CC(OC3=O)C4C1CC(O)CC4C(O)=O)OC(C2)C=5C=COC5
Synonyms:- 4H-3a,6-Methanofuro[2,3-d][2]benzoxepin-7-carboxylic acid, 2-(3-furanyl)decahydro-9-hydroxy-10b-methyl-4-oxo-, [2R-(2α,3aβ,6β,6aβ,7α,9α,10aα,10bβ)]-
- 4H-3a,6-Methanofuro[2,3-d][2]benzoxepin-7-carboxylic acid, 2-(3-furanyl)decahydro-9-hydroxy-10b-methyl-4-oxo-, (2R,3aS,6S,6aS,7R,9R,10aR,10bS)-
- (2R,3aS,6S,6aS,7R,9R,10aR,10bS)-2-(3-Furanyl)decahydro-9-hydroxy-10b-methyl-4-oxo-4H-3a,6-methanofuro[2,3-d][2]benzoxepin-7-carboxylic acid
- Diosbulbin C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Diosbulbin C
CAS:<p>Diosbulbin C has hepatotoxicity.</p>Formula:C19H22O7Purity:98%Color and Shape:SolidMolecular weight:362.378Diosbulbin C
CAS:<p>Diosbulbin C is a bioactive compound that belongs to the class of furanoditerpenoids, which is derived from the tubers of certain species of the Dioscorea plant, notably Dioscorea bulbifera. Its mode of action is primarily based on its cytotoxic properties, as it can induce apoptosis in various cancer cell lines by interfering with cellular structures and functions. The compound's efficacy is thought to be linked to its ability to modulate the activity of specific enzymes and signaling pathways critical for cell survival and proliferation.<br><br>Diosbulbin C has garnered attention in scientific research due to its potential applications in cancer therapy. It is extensively studied for its role in inducing apoptosis and inhibiting the growth of cancerous cells. The compound is valuable in exploring novel therapeutic strategies for targeting resistant cancer types and understanding the underlying mechanisms of cell death. Ongoing studies aim to further elucidate its pharmacokinetics, optimize its efficacy, and mitigate possible side effects, which are crucial steps in developing potential anticancer drugs from natural sources.</p>Formula:C19H22O7Purity:Min. 95%Molecular weight:362.4 g/mol


