
CAS 2009-74-7
:6-Methyl-3-hepten-2-one
Description:
6-Methyl-3-hepten-2-one, with the CAS number 2009-74-7, is an organic compound classified as a ketone. It features a seven-carbon chain with a double bond and a methyl group, contributing to its unique structure and reactivity. This compound is characterized by its distinctive odor, often described as fruity or floral, which makes it of interest in the flavor and fragrance industries. It is a colorless to pale yellow liquid at room temperature and is soluble in organic solvents. The presence of the carbonyl group (C=O) in its structure imparts typical ketone reactivity, allowing it to participate in various chemical reactions, such as nucleophilic addition and oxidation. Additionally, 6-Methyl-3-hepten-2-one can be synthesized through various methods, including the condensation of appropriate precursors. Its applications extend beyond flavoring and fragrance, potentially including use in organic synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C8H14O
InChI:InChI=1S/C8H14O/c1-7(2)5-4-6-8(3)9/h4,6-7H,5H2,1-3H3
InChI key:InChIKey=RSNMTAYSENLHOW-UHFFFAOYSA-N
SMILES:C(CC(C)C)=CC(C)=O
Synonyms:- 6-Methyl-3-hepten-2-one
- 2-Methyl-4-hepten-6-one
- 3-Hepten-2-one, 6-methyl-
- 2-Methyl-4-heptene-6-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
