CAS 20090-69-1

2-chloro-4-methylpyrimidin-5-amine

Description:

2-Chloro-4-methylpyrimidin-5-amine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 2-position and a methyl group at the 4-position, along with an amino group at the 5-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It is often used in pharmaceutical research and development, particularly in the synthesis of various biologically active compounds. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating properties of the amino group, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with many chemical substances, to ensure proper precautions are taken.

Formula: C₅H₆ClN₃

InChI: InChI=1/C5H6ClN3/c1-3-4(7)2-8-5(6)9-3/h2H,7H2,1H3

SMILES: Cc1c(cnc(Cl)n1)N

Synonyms:

• 5-Pyrimidinamine, 2-Chloro-4-Methyl-

5-Pyrimidinamine, 2-chloro-4-methyl-

CAS: 20090-69-1

Formula: C₅H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.5742

Ref: IN-DA002D33

2-Chloro-4-methylpyrimidin-5-amine

CAS: 20090-69-1

2-Chloro-4-methylpyrimidin-5-amine

Purity: 95%

Molecular weight: 143.57g/mol

Ref: 54-OR72132

5-Amino-2-chloro-4-methylpyrimidine

CAS: 20090-69-1

Formula: C₅H₆ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.57

Ref: 10-F079724