CAS 200933-14-8

2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide

Description:

2,4,6-Trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide is a sulfonamide compound characterized by its complex structure, which includes a sulfonamide functional group attached to a benzene ring that is further substituted with both methyl groups and a trifluoromethyl group. This compound typically exhibits properties such as high thermal stability and moderate solubility in organic solvents, owing to its aromatic nature and the presence of electronegative fluorine atoms. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical applications. Additionally, the presence of multiple methyl groups can affect the steric hindrance and reactivity of the molecule. As with many sulfonamides, it may exhibit antibacterial properties, although specific biological activities would depend on the context of its use and the presence of other functional groups. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₆H₁₆F₃NO₂S

InChI: InChI=1/C16H16F3NO2S/c1-10-7-11(2)15(12(3)8-10)23(21,22)20-14-6-4-5-13(9-14)16(17,18)19/h4-9,20H,1-3H3

SMILES: Cc1cc(C)c(c(C)c1)S(=O)(=O)Nc1cccc(c1)C(F)(F)F

Synonyms:

• Benzenesulfonamide, 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]-
• 2,4,6-Trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide

Benzenesulfonamide, 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]-

CAS: 200933-14-8

Formula: C₁₆H₁₆F₃NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 343.3639

Ref: IN-DA002D2O

m-3M3FBS

CAS: 200933-14-8

Formula: C₁₆H₁₆F₃NO₂S

Molecular weight: 343.36

Ref: 7W-GK5499

m-3M3FBS

CAS: 200933-14-8

m-3M3FBS

Purity: ≥98%

Molecular weight: 343.36g/mol

Ref: 54-BUP06672

2,4,6-Trimethyl-N-(3-(Trifluoromethyl)Phenyl)Benzenesulfonamide

CAS: 200933-14-8

2,4,6-Trimethyl-N-(3-(Trifluoromethyl)Phenyl)Benzenesulfonamide

Purity: 99%

Molecular weight: 343.36g/mol

Ref: 54-PC105159

m-3M3FBS

CAS: 200933-14-8

m-3M3FBS is a phospholipase C (PLC) activator.

Formula: C₁₆H₁₆F₃NO₂S

Purity: 99.66%

Color and Shape: Solid

Molecular weight: 343.36

Ref: TM-T8531

Benzenesulfonamide, 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]-

CAS: 200933-14-8

Purity: 99%

Molecular weight: 343.3599854

Ref: 10-F862164

m-3M3FBS

Controlled Product

CAS: 200933-14-8

Formula: C₁₆H₁₆F₃NO₂S

Color and Shape: Neat

Molecular weight: 343.364

Ref: TR-M103000