CAS 200958-40-3
:2-Bromo-4-nitro-1-(trifluoromethoxy)benzene
Description:
2-Bromo-4-nitro-1-(trifluoromethoxy)benzene is an aromatic compound characterized by the presence of a bromine atom, a nitro group, and a trifluoromethoxy group attached to a benzene ring. The bromine substituent typically enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The nitro group is a strong electron-withdrawing group, which can influence the compound's electronic properties and reactivity, often making it more susceptible to electrophilic aromatic substitution. The trifluoromethoxy group contributes to the compound's lipophilicity and can affect its solubility in organic solvents. This compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its unique structural features. Additionally, the presence of fluorine atoms can impart distinctive physical and chemical properties, such as increased stability and altered boiling and melting points compared to non-fluorinated analogs. Overall, 2-Bromo-4-nitro-1-(trifluoromethoxy)benzene is a versatile compound with potential utility in various chemical applications.
Formula:C7H3BrF3NO3
InChI:InChI=1/C7H3BrF3NO3/c8-5-3-4(12(13)14)1-2-6(5)15-7(9,10)11/h1-3H
SMILES:c1cc(c(cc1N(=O)=O)Br)OC(F)(F)F
Synonyms:- 2-Bromo-4-nitrophenyl trifluoromethyl ether
- Benzene, 2-bromo-4-nitro-1-(trifluoromethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4-nitro-1-(trifluoromethoxy)benzene, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H3BrF3NO3Purity:98%Color and Shape:Clear yellow, LiquidMolecular weight:286.0Benzene, 2-bromo-4-nitro-1-(trifluoromethoxy)-
CAS:Formula:C7H3BrF3NO3Purity:98%Color and Shape:LiquidMolecular weight:286.00282-Bromo-4-nitro-1-(trifluoromethoxy)benzene
CAS:2-Bromo-4-nitro-1-(trifluoromethoxy)benzenePurity:98%Molecular weight:286.00g/mol2-Bromo-4-nitro(trifluoromethoxy)benzene
CAS:Formula:C7H3BrF3NO3Purity:98%Color and Shape:LiquidMolecular weight:286.004



