CAS 20099-90-5

4-(Bromoacetyl)benzoic acid

Description:

4-(Bromoacetyl)benzoic acid, with the CAS number 20099-90-5, is an organic compound that features both a bromine atom and a carboxylic acid functional group. It is characterized by its aromatic structure, which includes a benzene ring substituted with a bromoacetyl group at the para position relative to the carboxylic acid. This compound typically appears as a white to off-white solid and is soluble in organic solvents, though its solubility in water may be limited due to the presence of the hydrophobic aromatic ring. The bromoacetyl group introduces reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of the carboxylic acid group allows for potential hydrogen bonding and further functionalization. Additionally, 4-(Bromoacetyl)benzoic acid can undergo various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks due to its bromine content.

Formula: C₉H₇BrO₃

InChI: InChI=1/C9H7BrO3/c10-5-8(11)6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,12,13)

SMILES: c1cc(ccc1C(=O)CBr)C(=O)O

Synonyms:

• Benzoic acid, 4-(2-bromoacetyl)-
• 4-(2-Bromo-acetyl)benzoic acid

Benzoic acid, 4-(2-bromoacetyl)-

CAS: 20099-90-5

Formula: C₉H₇BrO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.0541

Ref: IN-DA002D44

4-(Bromoacetyl)benzoic acid

CAS: 20099-90-5

4-(Bromoacetyl)benzoic acid

Formula: C₉H₇BrO₃

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 243.05g/mol

Ref: 54-OR400177

4-(2-Bromoacetyl)benzoic acid

CAS: 20099-90-5

Formula: C₉H₇BrO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.056

Ref: 10-F018116

4-(2-Bromoacetyl)benzoic Acid

Controlled Product

CAS: 20099-90-5

Formula: C₉H₇BrO₃

Color and Shape: Neat

Molecular weight: 243.054

Ref: TR-B679250