CAS 2010-61-9
:4-Methyl-α,α-bis(trifluoromethyl)benzenemethanol
Description:
4-Methyl-α,α-bis(trifluoromethyl)benzenemethanol, with the CAS number 2010-61-9, is an organic compound characterized by its complex structure featuring a benzene ring substituted with both methyl and trifluoromethyl groups. The presence of the trifluoromethyl groups significantly influences its chemical properties, imparting high electronegativity and lipophilicity, which can enhance its reactivity and solubility in organic solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate to high stability under standard conditions but may undergo reactions typical of alcohols, such as oxidation or esterification. The trifluoromethyl groups can also affect the compound's boiling point and melting point, making it distinct from similar compounds without these substituents. Due to its unique properties, it may find applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research and development. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can pose environmental and health risks.
Formula:C10H8F6O
InChI:InChI=1S/C10H8F6O/c1-6-2-4-7(5-3-6)8(17,9(11,12)13)10(14,15)16/h2-5,17H,1H3
InChI key:InChIKey=AOAVZPXKNQAALI-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)(F)F)(O)C1=CC=C(C)C=C1
Synonyms:- 1,1,1,3,3,3-Hexafluoro-2-(4-Methylphenyl)Propan-2-Ol
- 1,1,1,3,3,3-Hexafluoro-2-(4-methylphenyl)-2-propanol
- 1,1,1,3,3,3-Hexafluoro-2-(p-tolyl)-2-propanol
- 2-(4-Methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol
- 2-(p-Tolyl)-1,1,1,3,3,3-hexafluoro-2-propanol
- 4-(2-Hydroxyhexafluoro-2-propyl)toluene
- 4-Methyl-α,α-bis(trifluoromethyl)benzenemethanol
- Benzenemethanol, 4-methyl-α,α-bis(trifluoromethyl)-
- Hexafluoro-2-(p-tolyl)-2-propanol
- Hexafluoroptolylisopropanol
- Hexafluoroptolylpropanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,1,1,3,3,3-Hexafluoro-2-(4-methylphenyl)propan-2-ol
CAS:1,1,1,3,3,3-Hexafluoro-2-(4-methylphenyl)propan-2-olFormula:C10H8F6OPurity:96%Color and Shape: clear liquidMolecular weight:258.16g/molHexafluoro-2-(p-tolyl)isopropanol
CAS:Hexafluoro-2-(p-tolyl)isopropanol is a hydrophobic monomer that is added to dental materials, such as methacrylates and polymers, for the purpose of improving their resistance to water. It has been found to be effective in photopolymerization experiments due to its lack of susceptibility to photodegradation by ultraviolet light. Hexafluoro-2-(p-tolyl)isopropanol also has an optimal long-term effect on the environment, as it does not react with ozone or water vapor and is not toxic to aquatic life.
Formula:C10H8F6OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:258.16 g/mol



