CymitQuimica logo

CAS 201003-48-7

:

N-Fmoc-N'-Boc-N'-isopropyl-L-lysine

Description:
N-Fmoc-N'-Boc-N'-isopropyl-L-lysine is a protected derivative of the amino acid lysine, commonly used in peptide synthesis and research. The substance features two protective groups: the Fmoc (9-fluorenylmethoxycarbonyl) group and the Boc (tert-butyloxycarbonyl) group, which are employed to prevent unwanted reactions during the synthesis of peptides. The isopropyl group enhances the steric hindrance, which can influence the reactivity and solubility of the compound. This compound is typically white to off-white in appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but less soluble in water. Its stability under standard laboratory conditions makes it suitable for various applications in organic synthesis and biochemistry. The presence of the lysine backbone allows for further modifications, making it a versatile building block in the development of complex peptides and proteins. Proper handling and storage are essential, as with many chemical substances, to maintain its integrity and effectiveness in research applications.
Formula:C29H38N2O6
InChI:InChI=1S/C29H38N2O6/c1-19(2)31(28(35)37-29(3,4)5)17-11-10-16-25(26(32)33)30-27(34)36-18-24-22-14-8-6-12-20(22)21-13-7-9-15-23(21)24/h6-9,12-15,19,24-25H,10-11,16-18H2,1-5H3,(H,30,34)(H,32,33)/t25-/m0/s1
InChI key:LUGFCMICCJNLBC-VWLOTQADSA-N
SMILES:CC(C)N(CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)OC(C)(C)C
Synonyms:
  • Fmoc-Lys(Boc)(isopropyl)-OH
  • N-(9-Fluorenylmethyloxycarbonyl)-N'-tert-butoxycarbonyl-N'-isopropyl-L-lysine
  • Fmoc-Lys(iPr,Boc)-OH
Found 5 products.