CAS 201008-71-1

3,5-dimethyl-1H-pyrazole-4-carbaldehyde

Description:

3,5-Dimethyl-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound features two methyl groups at the 3 and 5 positions of the pyrazole ring, contributing to its unique chemical properties. The presence of a formyl group (-CHO) at the 4-position makes it an aldehyde, which is reactive and can participate in various chemical reactions, such as condensation and oxidation. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, 3,5-dimethyl-1H-pyrazole-4-carbaldehyde may exhibit specific physical properties such as solubility in organic solvents and distinct spectral characteristics, which can be analyzed using techniques like NMR and IR spectroscopy.

Formula: C₆H₈N₂O

InChI: InChI=1/C6H8N2O/c1-4-6(3-9)5(2)8-7-4/h3H,1-2H3,(H,7,8)

SMILES: Cc1c(C=O)c(C)n[nH]1

Synonyms:

• 1H-pyrazole-4-carboxaldehyde, 3,5-dimethyl-

1H-Pyrazole-4-carboxaldehyde, 3,5-dimethyl-

CAS: 201008-71-1

Formula: C₆H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 124.1405

Ref: IN-DA002D5T

3,5-Dimethyl-1H-pyrazole-4-carbaldehyde

CAS: 201008-71-1

3,5-Dimethyl-1H-pyrazole-4-carbaldehyde

Purity: 98%

Molecular weight: 124.14g/mol

Ref: 54-OR94112

3,5-Dimethyl-1H-pyrazole-4-carbaldehyde

CAS: 201008-71-1

Formula: C₆H₈N₂O

Purity: 95%

Color and Shape: No data available.

Molecular weight: 124.143

Ref: 10-F240160

3,5-Dimethyl-1H-pyrazole-4-carbaldehyde

Controlled Product

CAS: 201008-71-1

Formula: C₆H₈N₂O

Color and Shape: Neat

Molecular weight: 124.14

Ref: TR-D478950