CAS 201046-57-3
:L-(+)-Fmoc-ornithine hydrochloride
Description:
L-(+)-Fmoc-ornithine hydrochloride is a derivative of the amino acid ornithine, characterized by the presence of a 9-fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically utilized in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), due to its ability to protect the amino group while allowing for further coupling reactions. The Fmoc group is easily removed under basic conditions, facilitating the sequential addition of amino acids. L-(+)-Fmoc-ornithine itself is a chiral molecule, with the L-configuration being biologically relevant. As a hydrochloride salt, it is soluble in water and polar organic solvents, making it suitable for various biochemical applications. The compound's molecular structure includes a secondary amine, which contributes to its reactivity in peptide formation. Additionally, L-(+)-Fmoc-ornithine hydrochloride is often used in the synthesis of bioactive peptides and in research involving protein engineering and drug development. Its stability and ease of handling make it a valuable reagent in organic and medicinal chemistry.
Formula:C20H23ClN2O4
InChI:InChI=1/C20H22N2O4.ClH/c21-11-5-10-18(19(23)24)22-20(25)26-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17;/h1-4,6-9,17-18H,5,10-12,21H2,(H,22,25)(H,23,24);1H/t18-;/m0./s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](CCCN)C(=O)O)O.Cl
Synonyms:- (2S)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid hydrochloride
- Fmoc-Orn-OH・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Fmoc-Orn-OH · HCl
CAS:<p>Bachem ID: 4025982.</p>Formula:C20H22N2O4·HClPurity:99.2%Color and Shape:White PowderMolecular weight:390.87L(+)-Fmoc-ornithine HCl
CAS:Formula:C20H23ClN2O4Purity:97%Color and Shape:SolidMolecular weight:390.8606(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-aminopentanoic acid hydrochloride
CAS:<p>(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-aminopentanoic acid hydrochloride</p>Purity:97%Molecular weight:390.867g/mol(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-aminopentanoic acid hydrochloride
CAS:Formula:C20H23ClN2O4Purity:97%Color and Shape:SolidMolecular weight:390.86Fmoc-Nd-L-ornithine hydrochloride
CAS:<p>Please enquire for more information about Fmoc-Nd-L-ornithine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C20H22N2O4•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:390.86 g/mol




