CAS 201053-38-5

3-O-acetyl-2,6-anhydro-5-deoxy-1,4-bis-O-[tris(1-methylethyl)silyl]-D-arabino-hex-5-enitol

Description:

3-O-acetyl-2,6-anhydro-5-deoxy-1,4-bis-O-[tris(1-methylethyl)silyl]-D-arabino-hex-5-enitol is a complex organic compound characterized by its unique structural features, including multiple silyl groups that enhance its stability and solubility in organic solvents. The presence of the acetyl group suggests potential reactivity, particularly in esterification or acylation reactions. The anhydro sugar moiety indicates that it is derived from a sugar alcohol, which may impart specific biological activities or reactivity patterns. The tris(1-methylethyl)silyl groups provide steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound is likely to be of interest in synthetic organic chemistry and materials science, particularly in the development of silylated compounds for various applications, including drug delivery or as intermediates in organic synthesis. Its specific properties, such as melting point, solubility, and reactivity, would depend on the overall molecular structure and the presence of functional groups.

Formula: C₂₆H₅₂O₅Si₂

InChI: InChI=1/C26H52O5Si2/c1-17(2)32(18(3)4,19(5)6)29-16-25-26(30-23(13)27)24(14-15-28-25)31-33(20(7)8,21(9)10)22(11)12/h14-15,17-22,24-26H,16H2,1-13H3/t24-,25-,26-/m1/s1

SMILES: CC(C)[Si](C(C)C)(C(C)C)OC[C@@H]1[C@@H]([C@@H](C=CO1)O[Si](C(C)C)(C(C)C)C(C)C)OC(=O)C

Synonyms:

• 201053-38-5

4-O-Acetyl-3,6-di-O-triisopropylsilyl-D-galactal

CAS: 201053-38-5

4-O-Acetyl-3,6-di-O-triisopropylsilyl-D-galactal is a modified sugar that can be used as a chiral building block in the synthesis of complex carbohydrates. This product is available for custom synthesis.

Purity: Min. 95%

Ref: 3D-MA04290