CAS 20109-09-5

1-(Phenylethynyl)-1-cyclohexanol

Description:

1-(Phenylethynyl)-1-cyclohexanol, with the CAS number 20109-09-5, is an organic compound characterized by its unique structure that includes a cyclohexanol moiety and a phenylethynyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and fine chemicals. The presence of the phenylethynyl group contributes to its reactivity, allowing for various chemical transformations, including coupling reactions and functional group modifications. Additionally, the hydroxyl group in the cyclohexanol part of the molecule can participate in hydrogen bonding, influencing its solubility and interaction with other substances. Overall, 1-(Phenylethynyl)-1-cyclohexanol is a versatile compound in organic chemistry, with properties that make it valuable for research and industrial applications.

Formula: C₁₄H₁₆O

InChI: InChI=1/C14H16O/c15-14(10-5-2-6-11-14)12-9-13-7-3-1-4-8-13/h1,3-4,7-8,15H,2,5-6,10-11H2

SMILES: c1ccc(cc1)C#CC1(CCCCC1)O

Synonyms:

• 1-(Phenylethynyl)Cyclohexanol

1-(Phenylethynyl)cyclohexanol

CAS: 20109-09-5

Formula: C₁₄H₁₆O

Purity: 95%

Color and Shape: Solid

Molecular weight: 200.2762

Ref: IN-DA002D71

1-(Phenylethynyl)cyclohexan-1-ol

CAS: 20109-09-5

Purity: 98%

Molecular weight: 200.12

Ref: 10-F570628

1-(Phenylethynyl)cyclohexanol

CAS: 20109-09-5

Versatile small molecule scaffold

Formula: C₁₄H₁₆O

Purity: Min. 95%

Molecular weight: 200.28 g/mol

Ref: 3D-VAA10909