CAS 2011-06-5

2-benzyloxy-3-methoxybenzaldehyde

Description:

2-Benzyloxy-3-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of both benzyloxy and methoxy substituents on the benzene ring contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the aldehyde group makes it reactive, particularly in nucleophilic addition reactions, while the methoxy and benzyloxy groups can influence its reactivity and stability. Additionally, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and organic synthesis. Its molecular structure allows for potential applications in the development of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Proper handling and storage are essential due to its reactivity and potential health hazards associated with aldehyde compounds.

Formula: C₁₅H₁₄O₃

InChI: InChI=1/C15H14O3/c1-17-14-9-5-8-13(10-16)15(14)18-11-12-6-3-2-4-7-12/h2-10H,11H2,1H3

SMILES: COc1cccc(C=O)c1OCc1ccccc1

Benzaldehyde, 3-methoxy-2-(phenylmethoxy)-

CAS: 2011-06-5

Formula: C₁₅H₁₄O₃

Purity: 95%

Molecular weight: 242.2699

Ref: IN-DA002D7E

2-Benzyloxy-3-methoxybenzaldehyde

CAS: 2011-06-5

2-Benzyloxy-3-methoxybenzaldehyde is an enantiopure compound that has been shown to have antiproliferative effects on cancer cells. It was also found to have a strong binding affinity for DNA and protein. The antiproliferative effects of 2-Benzyloxy-3-methoxybenzaldehyde were found to be due to its ability to bind to dna and inhibit the enzyme activity of pyrazine-2-carboxylic acid, leading to a decrease in the production of proteins vital for cell division. 2-Benzyloxy-3-methoxybenzaldehyde has been shown to have anticancer activity against colorectal cancer cells and may serve as a lead compound for future drug development.

Formula: C₁₅H₁₄O₃

Purity: Min. 95%

Molecular weight: 242.27 g/mol

Ref: 3D-FB158927

2-(Benzyloxy)-3-methoxybenzaldehyde

CAS: 2011-06-5

Formula: C₁₅H₁₄O₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 242.274

Ref: 10-F425191