CAS 201216-39-9
:Piperidine, 4-phenyl-1-(4-phenylbutyl)-, (2Z)-2-butenedioate (1:1)
Description:
Piperidine, 4-phenyl-1-(4-phenylbutyl)-, (2Z)-2-butenedioate (1:1), with CAS number 201216-39-9, is a chemical compound that features a piperidine ring substituted with phenyl and butyl groups. This compound is characterized by its complex structure, which includes a butenedioate moiety, indicating the presence of a conjugated diene system that can participate in various chemical reactions. The piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in pharmaceuticals and agrochemicals. The presence of multiple phenyl groups suggests that the compound may exhibit significant hydrophobic properties, influencing its solubility and interaction with biological membranes. Additionally, the stereochemistry indicated by the (2Z) configuration suggests specific spatial arrangements that could affect the compound's reactivity and biological interactions. Overall, this compound's unique structural features may lead to interesting applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical determination.
Formula:C21H27NC4H4O4
InChI:InChI=1S/C21H27N.C4H4O4/c1-3-9-19(10-4-1)11-7-8-16-22-17-14-21(15-18-22)20-12-5-2-6-13-20;5-3(6)1-2-4(7)8/h1-6,9-10,12-13,21H,7-8,11,14-18H2;1-2H,(H,5,6)(H,7,8)/b;2-1-
InChI key:OASPNIMFGJVLES-BTJKTKAUSA-N
SMILES:C1CN(CCC1C2=CC=CC=C2)CCCCC3=CC=CC=C3.C(=C\C(=O)O)\C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Phenyl-1-(4-Phenylbutyl)Piperidine Maleate
CAS:Formula:C25H31NO4Purity:98%Color and Shape:SolidMolecular weight:409.51794-PPBP maleate
CAS:4-Phenyl-1-(4-phenylbutyl)piperidine maleateFormula:C25H31NO4Purity:98%Molecular weight:409.524-PPBP maleate
CAS:4-PPBP maleate: potent σ1 agonist, selective NR1a/2B NMDA antagonist, neuroprotective.Formula:C25H31NO4Purity:99.88%Color and Shape:SolidMolecular weight:409.524-Ppbp maleate
CAS:4-Ppbp Maleate is a plant extract that has been shown to stimulate stem cells and promote their migration into the injured site. It also stimulates the production of perivascular stem cells and promotes angiogenesis. 4-Ppbp Maleate has been shown to have anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines and chemokines, such as IL-6, IL-8, MCP1, TNFα, and IL-1β. This extract also inhibits the release of histamine and other inflammatory mediators in animal models.Formula:C25H31NO4Purity:Min. 95%Molecular weight:409.5 g/molRef: 3D-BIA21639
Discontinued product




