CAS 201227-38-5

5-bromo-1H-indazole-3-carbaldehyde

Description:

5-Bromo-1H-indazole-3-carbaldehyde is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity is influenced by the electrophilic nature of the aldehyde group, making it suitable for various chemical transformations, including condensation reactions and nucleophilic additions. The bromine substituent can also participate in further functionalization, allowing for the development of more complex molecules. Due to its structural features, 5-bromo-1H-indazole-3-carbaldehyde may serve as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, or other biologically active compounds. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₅BrN₂O

InChI: InChI=1/C8H5BrN2O/c9-5-1-2-7-6(3-5)8(4-12)11-10-7/h1-4H,(H,10,11)

SMILES: c1cc2c(cc1Br)c(C=O)n[nH]2

Synonyms:

• 1H-indazole-3-carboxaldehyde, 5-bromo-
• 5-Bromo indazole-3-carboxaldehyde

1H-Indazole-3-carboxaldehyde, 5-bromo-

CAS: 201227-38-5

Formula: C₈H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.0421

Ref: IN-DA002DA8

5-Bromo-1H-indazole-3-carbaldehyde

CAS: 201227-38-5

5-Bromo-1H-indazole-3-carbaldehyde

Purity: 98%

Molecular weight: 225.04g/mol

Ref: 54-OR305082

5-Bromo-1H-indazole-3-carbaldehyde

CAS: 201227-38-5

Formula: C₈H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.045

Ref: 10-F064557