CAS 201227-39-6

5-Bromo-1H-indazole-3-carbonitrile

Description:

5-Bromo-1H-indazole-3-carbonitrile is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position and a cyano group (-C≡N) at the 3-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is often utilized in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The cyano group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the bromine substituent can serve as a site for further functionalization, enhancing its utility in creating more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks, and proper storage conditions should be maintained to ensure stability.

Formula: C₈H₄BrN₃

InChI: InChI=1/C8H4BrN3/c9-5-1-2-7-6(3-5)8(4-10)12-11-7/h1-3H,(H,11,12)

SMILES: c1cc2c(cc1Br)c(C#N)n[nH]2

Synonyms:

• 1H-Indazole-3-carbonitrile, 5-bromo-

1H-Indazole-3-carbonitrile, 5-bromo-

CAS: 201227-39-6

Formula: C₈H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.0415

Ref: IN-DA002DA7

5-Bromo-1H-indazole-3-carbonitrile

CAS: 201227-39-6

5-Bromo-1H-indazole-3-carbonitrile

Purity: 99%

Molecular weight: 222.04146g/mol

Ref: 54-OR30737

5-Bromo-1H-indazole-3-carbonitrile

CAS: 201227-39-6

Formula: C₈H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 222.045

Ref: 10-F225152

5-Bromo-1H-indazole-3-carbonitrile

CAS: 201227-39-6

5-Bromo-1H-indazole-3-carbonitrile is a high quality, versatile building block that can be used in the synthesis of complex compounds. It has been described as a "useful intermediate" and a "useful scaffold".

Formula: C₈H₄BrN₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 222.04 g/mol

Ref: 3D-FB51079

5-BROMO-1H-INDAZOLE-3-CARBONITRILE

CAS: 201227-39-6

Purity: 97%

Molecular weight: 222.0449982

Ref: 10-F799960