CAS 20125-39-7
:N6-(2-phenylethyl)adenosine
Description:
N6-(2-phenylethyl)adenosine is a modified nucleoside derivative of adenosine, characterized by the substitution of a 2-phenylethyl group at the nitrogen atom in the N6 position of the adenine base. This modification enhances its biological activity and receptor selectivity, particularly towards adenosine receptors, which are involved in various physiological processes including neurotransmission, inflammation, and cardiovascular regulation. The compound exhibits properties typical of adenosine analogs, such as potential anti-inflammatory and neuroprotective effects. Its structure allows for increased lipophilicity, which may influence its pharmacokinetics and bioavailability. N6-(2-phenylethyl)adenosine is of interest in pharmacological research, particularly in the context of developing therapeutic agents targeting adenosine receptors for conditions like pain, anxiety, and neurodegenerative diseases. As with many nucleoside analogs, its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its interactions with various biological systems.
Formula:C18H21N5O4
InChI:InChI=1/C18H21N5O4/c24-8-12-14(25)15(26)18(27-12)23-10-22-13-16(20-9-21-17(13)23)19-7-6-11-4-2-1-3-5-11/h1-5,9-10,12,14-15,18,24-26H,6-8H2,(H,19,20,21)
SMILES:c1ccc(cc1)CCNc1c2c(ncn1)n(cn2)C1C(C(C(CO)O1)O)O
Synonyms:- 9-pentofuranosyl-N-(2-phenylethyl)-9H-purin-6-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N6-(2-Phenylethyl)adenosine
CAS:Formula:C18H21N5O4Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:371.39N6-(2-Phenylethyl)adenosine
CAS:N6-(2-Phenylethyl)adenosine (N6-PEA) is an adenosine analogue that is a chemosensitive agent. It has been shown to inhibit cancer cell growth and to induce apoptosis in vitro. N6-PEA binds to the adenosine receptor and blocks viral replication, including human pathogens such as herpes simplex virus type 1 and 2, cytomegalovirus, and varicella zoster virus. N6-PEA also has antiviral effects against HIV type 1 in cell-based assays. It is hydrophobic and binds to the adenosine receptor with high affinity. N6-PEA was modeled using molecular dynamics simulations with a combination of computational chemistry techniques, which revealed its binding mode at the adenosine receptor site.
Formula:C18H21N5O4Purity:Min. 95%Molecular weight:371.39 g/molN6-(2-Phenylethyl)adenosine
CAS:N6-(2-Phenylethyl)adenosine (N6-Phenethyladenosine) is an adenosine derivative and an agonist of adenosine receptors with Ki values of 11.8 nM and 30.1 nM forFormula:C18H21N5O4Purity:99.83%Color and Shape:SolidMolecular weight:371.39



