CAS 2013-26-5
:Butanoic acid, 2-oxo-, sodium salt (1:1)
Description:
Butanoic acid, 2-oxo-, sodium salt (1:1), commonly known as sodium 2-oxobutanoate, is a sodium salt derived from 2-oxobutanoic acid, which is a four-carbon dicarboxylic acid. This compound typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the sodium ion, which enhances its ionic character. It is often used in biochemical applications, particularly in metabolic studies and as a potential precursor in various synthetic pathways. The presence of the keto group (oxo) in its structure allows it to participate in various chemical reactions, including condensation and oxidation. As a salt, it exhibits properties typical of ionic compounds, such as high melting points and conductivity in solution. Additionally, it may serve as a buffering agent in biological systems, helping to maintain pH stability. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C4H6O3·Na
InChI:InChI=1S/C4H6O3.Na/c1-2-3(5)4(6)7;/h2H2,1H3,(H,6,7);
InChI key:InChIKey=XLTHMCKKCRLNGQ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CC)=O.[Na]
Synonyms:- Butanoic acid, 2-oxo-, sodium salt
- Butanoic acid, 2-oxo-, sodium salt (1:1)
- Butyric acid, 2-oxo-, sodium salt
- Sodium 2-oxobutyrate
- Sodium α-ketobutyrate
- α-Ketobutyric acid sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Sodium 2-Oxobutyrate
CAS:Formula:C4H5NaO3Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:124.07Butanoic acid, 2-oxo-, sodium salt (1:1)
CAS:Formula:C4H5NaO3Purity:98%Color and Shape:SolidMolecular weight:124.0705α-Ketobutyric acid sodium salt
CAS:Formula:CH3CH2COCOONaPurity:≥ 97.0% (anhydrous)Color and Shape:White powderMolecular weight:124.07Sodium 2-Ketobutyrate-3,3,4,4,4-d5
CAS:Formula:CD3CD2C(O)COONaPurity:98 atom % DColor and Shape:White SolidMolecular weight:129.04502Sodium 2-oxobutanoate
CAS:<p>Sodium 2-oxobutanoate is an organic compound commonly used as an acidity regulator, leavening agent, and preservative.</p>Formula:C4H5NaO3Color and Shape:SolidMolecular weight:124.072-Oxobutyric acid, sodium salt
CAS:2-Oxobutyric acid, sodium saltPurity:98%Color and Shape:White PowderMolecular weight:124.07g/mol








