CAS 201335-88-8
:Fmoc-D-Tyr(Me)-OH
Description:
Fmoc-D-Tyr(Me)-OH, also known as 9-fluorenylmethoxycarbonyl-D-tyrosine methyl ester, is a protected amino acid commonly used in peptide synthesis. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The presence of the D-tyrosine residue contributes to the structural diversity of peptides, as it is an isomer of the more common L-tyrosine. The methyl ester group enhances the lipophilicity of the compound, which can influence solubility and reactivity in various solvents. This compound is typically utilized in solid-phase peptide synthesis (SPPS) due to its stability under standard coupling conditions and ease of deprotection. Its molecular structure includes a phenolic hydroxyl group, which can participate in hydrogen bonding and contribute to the overall properties of the resulting peptides. As with many amino acid derivatives, careful handling and storage are recommended to maintain its integrity and reactivity.
Formula:C25H23NO5
InChI:InChI=1/C25H23NO5/c1-30-17-12-10-16(11-13-17)14-23(24(27)28)26-25(29)31-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/t23-/m1/s1
SMILES:COc1ccc(cc1)C[C@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-methyl-D-tyrosine
- Fmoc-D-4-Methoxyphenylalanine
- Fmoc-4-Methoxy-D-phenylalanine
- Fmoc-D-4-Methoxyphe
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-Fmoc-O-methyl-D-tyrosine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C25H23NO5Purity:98%Molecular weight:417.46Fmoc-D-Tyr(Me)-OH
CAS:Bachem ID: 4025244.
Formula:C25H23NO5Purity:99.8%Color and Shape:White PowderMolecular weight:417.46D-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-methyl-
CAS:Formula:C25H23NO5Purity:98%Color and Shape:SolidMolecular weight:417.4538






