CAS 201335-92-4

D-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, dimethyl phosphate (ester)

Description:

D-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, dimethyl phosphate (ester) is a chemical compound characterized by its structure, which includes a tyrosine amino acid backbone modified with a fluorenylmethoxycarbonyl (Fmoc) protecting group and a dimethyl phosphate ester. The Fmoc group is commonly used in peptide synthesis to protect the amino group of the amino acid, facilitating the formation of peptide bonds while preventing unwanted reactions. The dimethyl phosphate moiety introduces a phosphate ester functionality, which can enhance solubility and reactivity in biological systems. This compound is typically utilized in organic synthesis, particularly in the field of peptide chemistry, where it serves as an intermediate in the synthesis of more complex molecules. Its properties include being soluble in organic solvents and having a relatively stable structure under standard laboratory conditions. As with many phosphates, it may exhibit biological activity, making it of interest in medicinal chemistry and biochemistry. Proper handling and storage are essential due to potential reactivity and toxicity associated with phosphate esters.

Formula: C₂₆H₂₆NO₈P

InChI: InChI=1S/C26H26NO8P/c1-32-36(31,33-2)35-18-13-11-17(12-14-18)15-24(25(28)29)27-26(30)34-16-23-21-9-5-3-7-19(21)20-8-4-6-10-22(20)23/h3-14,23-24H,15-16H2,1-2H3,(H,27,30)(H,28,29)/t24-/m1/s1

InChI key: InChIKey=ZQHCDMSMVMNCER-XMMPIXPASA-N

SMILES: C(OC(N[C@H](CC1=CC=C(OP(OC)(OC)=O)C=C1)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• D-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, dimethyl phosphate (ester)

Fmoc-O-dimethylphospho-D-tyrosine

CAS: 201335-92-4

Molecular weight: 511.46

Ref: 7W-GM6892