CAS 20135-60-8
:1-(octyloxy)-2,5-dihydro-1H-phosphole 1-oxide
Description:
1-(Octyloxy)-2,5-dihydro-1H-phosphole 1-oxide is an organophosphorus compound characterized by its unique phosphole ring structure, which is a five-membered heterocycle containing phosphorus. This compound features an octyloxy substituent, which contributes to its hydrophobic properties and influences its solubility in organic solvents. The presence of the phosphole ring imparts distinct electronic properties, making it of interest in various applications, including organic electronics and materials science. The 1-oxide functional group enhances its reactivity and stability, allowing for potential use in chemical synthesis and catalysis. Additionally, the compound's molecular structure suggests it may exhibit interesting photophysical properties, which could be leveraged in optoelectronic devices. Overall, 1-(octyloxy)-2,5-dihydro-1H-phosphole 1-oxide is notable for its combination of phosphorus chemistry and organic functionality, making it a subject of interest in both academic research and industrial applications.
Formula:C12H23O2P
InChI:InChI=1/C12H23O2P/c1-2-3-4-5-6-7-10-14-15(13)11-8-9-12-15/h8-9H,2-7,10-12H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
