CAS 20137-37-5

Rotundic acid

Description:

Rotundic acid, with the CAS number 20137-37-5, is a naturally occurring triterpenoid compound primarily extracted from the fruit of the plant species known as "Rotundus." It is characterized by its unique chemical structure, which includes a pentacyclic triterpene framework. Rotundic acid exhibits various biological activities, including anti-inflammatory, antimicrobial, and potential anticancer properties, making it of interest in pharmacological research. The compound is typically found in the form of a white to off-white crystalline solid and is soluble in organic solvents. Its melting point and specific solubility characteristics can vary based on purity and environmental conditions. Rotundic acid's potential applications in medicine and cosmetics are being explored, particularly due to its bioactive properties. As with many natural products, further studies are necessary to fully understand its mechanisms of action and potential therapeutic uses.

Formula: C₃₀H₄₈O₅

InChI: InChI=1S/C30H48O5/c1-18-9-14-30(24(33)34)16-15-27(4)19(23(30)29(18,6)35)7-8-21-25(2)12-11-22(32)26(3,17-31)20(25)10-13-28(21,27)5/h7,18,20-23,31-32,35H,8-17H2,1-6H3,(H,33,34)/t18-,20-,21-,22+,23-,25+,26+,27-,28-,29-,30+/m1/s1

InChI key: InChIKey=YLHQFGOOMKJFLP-LTFXOGOQSA-N

SMILES: C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](CO)(C)[C@@H](O)CC5)[H])[H])([C@](C)(O)[C@H](C)CC2)[H]

Synonyms:

• Urs-12-en-28-oic acid, 3β,19,23-trihydroxy-
• 3β,19α,23-Trihydroxyurs-12-en-28-oic acid
• (3β,4α)-3,19,23-Trihydroxyurs-12-en-28-oic acid
• Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-
• Rotundic acid

Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-

CAS: 20137-37-5

Formula: C₃₀H₄₈O₅

Purity: 98%

Molecular weight: 488.6991

Ref: IN-DA002DDC

Rotundic acid

CAS: 20137-37-5

Formula: C₃₀H₄₈O₅

Molecular weight: 488.71

Ref: 7W-GY9910

Rotundic acid

CAS: 20137-37-5

Rotundic acid

Purity: ≥95%

Molecular weight: 488.7g/mol

Ref: 54-BUP05930

Rotundic acid

CAS: 20137-37-5

Formula: C₃₀H₄₈O₅

Purity: 95%~99%

Molecular weight: 488.709

Ref: BP-BP1225

Rotundic acid

CAS: 20137-37-5

Rotundic acid fights various cancers: HepG2, A375, NCI-H446, MCF-7, and HT-29.

Formula: C₃₀H₄₈O₅

Purity: 96.91% - 99.97%

Color and Shape: Solid

Molecular weight: 488.7

Ref: TM-T5S0506

Rotundic acid

CAS: 20137-37-5

Carboxylic acid with alcohol function

Formula: C₃₀H₄₈O₅

Purity: ≥ 95.0 % (HPLC)

Molecular weight: 488.7

Ref: 5G-84256

Rotundic acid

Controlled Product

CAS: 20137-37-5

Rotundic acid is a triterpenoid compound, which is isolated from natural plant sources, such as the Chinese herb *Ilex rotunda*. It is known for its multifaceted biological activities, primarily due to its interaction with cellular signaling pathways. Rotundic acid's mode of action includes modulation of inflammatory cascades and inhibition of specific enzymes involved in the proliferation of cancer cells. This compound interacts with molecular targets such as NF-kB and MAPKs, which play a crucial role in the cellular inflammatory response and the regulation of apoptosis.

Formula: C₃₀H₄₈O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 488.7 g/mol

Ref: 3D-FR73838