CAS 20137-37-5: Rotundic acid
Description:Rotundic acid, with the CAS number 20137-37-5, is a naturally occurring triterpenoid compound primarily extracted from the fruit of the plant species known as "Rotundus." It is characterized by its unique chemical structure, which includes a pentacyclic triterpene framework. Rotundic acid exhibits various biological activities, including anti-inflammatory, antimicrobial, and potential anticancer properties, making it of interest in pharmacological research. The compound is typically found in the form of a white to off-white crystalline solid and is soluble in organic solvents. Its melting point and specific solubility characteristics can vary based on purity and environmental conditions. Rotundic acid's potential applications in medicine and cosmetics are being explored, particularly due to its bioactive properties. As with many natural products, further studies are necessary to fully understand its mechanisms of action and potential therapeutic uses.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-18-9-14-30(24(33)34)16-15-27(4)19(23(30)29(18,6)35)7-8-21-25(2)12-11-22(32)26(3,17-31)20(25)10-13-28(21,27)5/h7,18,20-23,31-32,35H,8-17H2,1-6H3,(H,33,34)/t18-,20-,21-,22+,23-,25+,26+,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=YLHQFGOOMKJFLP-LTFXOGOQSA-N
SMILES:O=C(O)C12CCC(C)C(O)(C)C2C3=CCC4C5(C)CCC(O)C(C)(CO)C5CCC4(C)C3(C)CC1
- Synonyms:
- Urs-12-en-28-oic acid, 3β,19,23-trihydroxy-
- 3β,19α,23-Trihydroxyurs-12-en-28-oic acid
- (3β,4α)-3,19,23-Trihydroxyurs-12-en-28-oic acid
- Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-
- Rotundic acid
