CAS 20137-37-5
:Rotundic acid
Description:
Rotundic acid, with the CAS number 20137-37-5, is a naturally occurring triterpenoid compound primarily extracted from the fruit of the plant species known as "Rotundus." It is characterized by its unique chemical structure, which includes a pentacyclic triterpene framework. Rotundic acid exhibits various biological activities, including anti-inflammatory, antimicrobial, and potential anticancer properties, making it of interest in pharmacological research. The compound is typically found in the form of a white to off-white crystalline solid and is soluble in organic solvents. Its melting point and specific solubility characteristics can vary based on purity and environmental conditions. Rotundic acid's potential applications in medicine and cosmetics are being explored, particularly due to its bioactive properties. As with many natural products, further studies are necessary to fully understand its mechanisms of action and potential therapeutic uses.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-18-9-14-30(24(33)34)16-15-27(4)19(23(30)29(18,6)35)7-8-21-25(2)12-11-22(32)26(3,17-31)20(25)10-13-28(21,27)5/h7,18,20-23,31-32,35H,8-17H2,1-6H3,(H,33,34)/t18-,20-,21-,22+,23-,25+,26+,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=YLHQFGOOMKJFLP-LTFXOGOQSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](CO)(C)[C@@H](O)CC5)[H])[H])([C@](C)(O)[C@H](C)CC2)[H]
Synonyms:- Urs-12-en-28-oic acid, 3β,19,23-trihydroxy-
- 3β,19α,23-Trihydroxyurs-12-en-28-oic acid
- (3β,4α)-3,19,23-Trihydroxyurs-12-en-28-oic acid
- Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-
- Rotundic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Urs-12-en-28-oic acid, 3,19,23-trihydroxy-, (3β,4α)-
CAS:Formula:C30H48O5Purity:98%Molecular weight:488.6991Rotundic acid
CAS:Rotundic acid fights various cancers: HepG2, A375, NCI-H446, MCF-7, and HT-29.Formula:C30H48O5Purity:96.91% - 99.97%Color and Shape:SolidMolecular weight:488.70Rotundic acid
CAS:Carboxylic acid with alcohol functionFormula:C30H48O5Purity:≥ 95.0 % (HPLC)Molecular weight:488.7Rotundic acid
CAS:Controlled ProductRotundic acid is a triterpenoid compound, which is isolated from natural plant sources, such as the Chinese herb *Ilex rotunda*. It is known for its multifaceted biological activities, primarily due to its interaction with cellular signaling pathways. Rotundic acid's mode of action includes modulation of inflammatory cascades and inhibition of specific enzymes involved in the proliferation of cancer cells. This compound interacts with molecular targets such as NF-kB and MAPKs, which play a crucial role in the cellular inflammatory response and the regulation of apoptosis.Formula:C30H48O5Purity:Min. 95%Color and Shape:PowderMolecular weight:488.7 g/mol






