CAS 201466-03-7
:H-p-Bz-D-Phe-OH
Description:
H-p-Bz-D-Phe-OH, also known as a phenylalanine derivative, is a chemical compound characterized by its structure, which includes a phenyl group (benzene ring) and a D-phenylalanine moiety. This compound is often utilized in biochemical and pharmaceutical research due to its potential applications in peptide synthesis and as a building block for various bioactive molecules. The presence of the hydroxyl group (-OH) indicates that it is a phenolic compound, which can influence its solubility and reactivity. H-p-Bz-D-Phe-OH may exhibit specific interactions with biological targets, making it of interest in studies related to drug design and development. Its unique stereochemistry, being a D-enantiomer, can affect its biological activity and interactions with enzymes or receptors. As with many chemical substances, safety and handling precautions should be observed, and its properties should be evaluated in the context of its intended use in research or application.
Formula:C16H15NO3
InChI:InChI=1/C16H15NO3/c17-14(16(19)20)10-11-6-8-13(9-7-11)15(18)12-4-2-1-3-5-12/h1-9,14H,10,17H2,(H,19,20)/t14-/m1/s1
SMILES:c1ccc(cc1)C(=O)c1ccc(cc1)C[C@H](C(=O)O)N
Synonyms:- D-4-benzoylphenylalanine
- (2R)-2-ammonio-3-[4-(phenylcarbonyl)phenyl]propanoate
- 4-Benzoyl-D-phenylalanine
- H-D-Bpa-Oh
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-p-Bz-D-Phe-OH
CAS:Bachem ID: 4017834.
Formula:C16H15NO3Purity:> 99%Color and Shape:White PowderMolecular weight:269.34-Benzoyl-D-phenylalanine
CAS:4-Benzoyl-D-phenylalanine is a high quality chemical that is used as an intermediate in the synthesis of other compounds. It is a complex compound that has been shown to be useful in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. 4-Benzoyl-D-phenylalanine can be used as a reagent and it has been shown to have a wide range of uses, including as a building block for more complex molecules. This chemical is also used in research and development, as it can be used to produce speciality chemicals and research chemicals. 4-Benzoyl-D-phenylalanine can also be used as a versatile building block for reactions that require an aromatic group.Formula:C16H15NO3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:269.3 g/mol




