CAS 201594-84-5
:(S)-2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine
Description:
(S)-2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine, with the CAS number 201594-84-5, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound includes a chlorophenyl group, which contributes to its lipophilicity and potential biological activity. The presence of a piperidinyloxy moiety suggests that it may interact with biological targets, possibly influencing neurotransmitter systems or other physiological pathways. This compound is likely to exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the presence of the chlorophenyl and piperidine functionalities. Its stereochemistry (S configuration) may play a crucial role in its pharmacological profile, affecting how it interacts with biological receptors. Overall, this compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C17H19ClN2O
InChI:InChI=1/C17H19ClN2O/c18-14-6-4-13(5-7-14)17(16-3-1-2-10-20-16)21-15-8-11-19-12-9-15/h1-7,10,15,17,19H,8-9,11-12H2/t17-/m0/s1
SMILES:c1ccnc(c1)[C@H](c1ccc(cc1)Cl)OC1CCNCC1
Synonyms:- 2-[(S)-(4-Chlorophenyl)-(4-piperidinyloxy)-methyl]-pyridine
- 2-[(S)-(4-chlorophenyl)(piperidin-4-yloxy)methyl]pyridine
- (S)-4-[1-(4-Chlorophenyl)-1-(2-pyridyl) methoxy] piperidine (for Bepotastine)
- (S)-4-[1-(4-Chlorophenyl)-1-(2-pyridyl) methoxy] piperidine
- Bepotastine Intermediate-1
- (S)-2-((4-chlorophenyl)(piperidin-4-yloxy)methyl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyridine, 2-[(S)-(4-chlorophenyl)(4-piperidinyloxy)methyl]-
CAS:Formula:C17H19ClN2OPurity:96%Color and Shape:LiquidMolecular weight:302.7986(S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine
CAS:(S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridinePurity:99%Molecular weight:302.80g/mol(S)-2-((4-Chlorophenyl)(piperidin-4-yloxy)methyl)pyridine
CAS:Purity:95.0%Molecular weight:302.79998779296875(S)-2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine
CAS:Controlled ProductApplications (S)-2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine is used as a reagent to prepare optically active 4-[(4-chlorophenyl-2-pyridyl)methoxy]piperidine, a compound that is used as an intermediate in the synthesis of antihistamines and antiallergy agents. (S)-2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine is also an intermediate of Bepotastine besylate (B317000), a non-sedating H1-antagonist that has anti-inflammatory activity.
References Kita, J. Preparation of Optically Active 4-[(4-Chlorophenyl-2-pyridyl)methoxy]piperidine As A Material For Antihistamines and Antiallergy Agents. Jpn. Kokai Tokkyo Koho JP 10182635. Jul 7, 1998; Ohashi, R., et al.: Drug Metab. Disp., 34, 793 (2006)Formula:C17H19ClN2OColor and Shape:NeatMolecular weight:302.8




