CAS 2016-99-1

2,6-Dibromopyridine-4-carboxylic acid

Description:

2,6-Dibromopyridine-4-carboxylic acid is an organic compound characterized by its pyridine ring substituted with two bromine atoms and a carboxylic acid group. The presence of the bromine atoms at the 2 and 6 positions of the pyridine ring significantly influences its chemical reactivity and physical properties, such as solubility and boiling point. The carboxylic acid functional group contributes to its acidity and ability to participate in various chemical reactions, including esterification and amidation. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the electronegative bromine atoms and the carboxylic acid group. It is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Safety precautions should be observed when handling this compound, as brominated compounds can be hazardous.

Formula: C₆H₃Br₂NO₂

InChI: InChI=1/C6H3Br2NO2/c7-4-1-3(6(10)11)2-5(8)9-4/h1-2H,(H,10,11)

SMILES: c1c(cc(Br)nc1Br)C(=O)O

Synonyms:

• 2,6-Dibromoisonicotinic acid

4-Pyridinecarboxylic acid, 2,6-dibromo-

CAS: 2016-99-1

Formula: C₆H₃Br₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 280.9015

Ref: IN-DA002DJH

2,6-Dibromoisonicotinic acid

CAS: 2016-99-1

2,6-Dibromoisonicotinic acid

Formula: C₆H₃Br₂NO₂

Purity: 95%

Color and Shape: white to off white solid

Molecular weight: 280.90g/mol

Ref: 54-OR2261

2,6-Dibromopyridine-4-carboxylic acid

CAS: 2016-99-1

Formula: C₆H₃Br₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 280.903

Ref: 10-F046182