CAS 201653-76-1

1H-Imidazole (OC-6-11)-tetrachloro(1H-imidazole-κN3)[1,1′-(sulfinyl-κS)bis[methane]]ruthenate(1-) (1:1)

Description:

1H-Imidazole (OC-6-11)-tetrachloro(1H-imidazole-κN3)[1,1′-(sulfinyl-κS)bis[methane]]ruthenate(1-) is a complex chemical compound featuring a ruthenium center coordinated with multiple ligands, including imidazole derivatives and a sulfinyl group. The presence of tetrachloro ligands indicates that the ruthenium is in a higher oxidation state, typically +3 or +4, which is common in coordination chemistry. The imidazole moieties contribute to the compound's potential biological activity, as imidazole is known for its role in various biochemical processes. The sulfinyl group may enhance the compound's solubility and stability in different solvents. This compound is likely to exhibit interesting electronic properties due to the metal-ligand interactions, making it a candidate for applications in catalysis or as a potential therapeutic agent. Its unique structure and coordination environment can influence its reactivity and interaction with biological systems, warranting further investigation into its properties and potential uses in medicinal chemistry or materials science.

Formula: C₅H₁₀Cl₄N₂ORuS·C₃H₄N₂·H

InChI: InChI=1S/2C3H4N2.C2H6OS.4ClH.Ru/c2*1-2-5-3-4-1;1-4(2)3;;;;;/h2*1-3H,(H,4,5);1-2H3;4*1H;/q;;;;;;;+3/p-3

InChI key: InChIKey=RJZBTXZRLXLLKO-UHFFFAOYSA-K

SMILES: [Ru+3]([S](C)(C)=O)([Cl-])([Cl-])([Cl-])([Cl-])[N]=1C=CNC1.[H+].C1=CN=CN1

Synonyms:

• Ruthenate(1-), tetrachloro(1H-imidazole-κN3)[(sulfinyl-κS)bis[methane]]-, (OC-6-11)-, hydrogen, compd. with 1H-imidazole (1:1)
• Ruthenate(1-), tetrachloro(1H-imidazole-κN3)[1,1′-(sulfinyl-κS)bis[methane]]-, (OC-6-11)-, hydrogen, compd. with 1H-imidazole (1:1:1)
• NAMI-A
• 1H-Imidazole (OC-6-11)-tetrachloro(1H-imidazole-κN3)[1,1′-(sulfinyl-κS)bis[methane]]ruthenate(1-) (1:1)
• 1H-Imidazole, mono[(OC-6-11)-tetrachloro(1H-imidazole-κN3)[(sulfinyl-κS)bis[methane]]ruthenate(1-)]

NAMI-A

CAS: 201653-76-1

NAMI-A

Purity: ≥98%

Molecular weight: 458.18g/mol

Ref: 54-BUP01795

NAMI-A

CAS: 201653-76-1

Nami-A is an experimental drug that has been shown to have significant cytotoxicity against carcinoma cell lines and solid tumours. Nami-A is a small molecule that binds to integrin receptors on the surface of cells, inhibiting the production of matrix metalloproteinase-9 (MMP-9). In vivo studies with Nami-A in mice showed that mitochondrial membrane potential was reduced and there was a decrease in redox potentials. The MMP-9 inhibition by Nami-A may be due to its ability to inhibit oxidative stress.

Formula: C₈H₁₅Cl₄N₄OSRu

Purity: Min. 95%

Molecular weight: 458.18 g/mol

Ref: 3D-BIA65376

NAMI-A

CAS: 201653-76-1

NAMI-A is a ruthenium-based compound with selective activity against tumor metastasis.NAMI-A inhibits cancer cell adhesion and migration.

Formula: C₈H₁₅Cl₄N₄ORuS

Purity: 98%

Color and Shape: Solid

Molecular weight: 458.18

Ref: TM-T16266