
CAS 20170-20-1
:Difenamizole
Description:
Difenamizole, with the CAS number 20170-20-1, is a chemical compound that belongs to the class of non-steroidal anti-inflammatory drugs (NSAIDs). It is primarily recognized for its analgesic and anti-inflammatory properties. Difenamizole is characterized by its ability to inhibit the enzyme cyclooxygenase (COX), which plays a crucial role in the synthesis of prostaglandins, compounds that mediate inflammation and pain. The substance is typically administered in various formulations, including tablets and injections, and is used to manage pain and inflammation in both human and veterinary medicine. Its chemical structure features a heterocyclic ring, contributing to its pharmacological activity. Difenamizole is known for its relatively rapid onset of action, making it effective for acute pain relief. However, like many NSAIDs, it may be associated with gastrointestinal side effects and other adverse reactions, necessitating careful consideration of its use in patients with certain health conditions. Overall, Difenamizole is a valuable therapeutic agent in the management of pain and inflammation.
Formula:C20H22N4O
InChI:InChI=1S/C20H22N4O/c1-15(23(2)3)20(25)21-19-14-18(16-10-6-4-7-11-16)22-24(19)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,21,25)
InChI key:InChIKey=PCXMKBOWWVXEDT-UHFFFAOYSA-N
SMILES:N(C(C(N(C)C)C)=O)C=1N(N=C(C1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 2-(Dimethylamino)-N-(1,3-diphenyl-1H-pyrazol-5-yl)propanamide
- Propionamide, 2-(dimethylamino)-N-(1,3-diphenylpyrazol-5-yl)-
- Difenamizole
- AP 14
- Propanamide, 2-(dimethylamino)-N-(1,3-diphenyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Difenamizole
CAS:<p>Difenamizole: NSAID, pyrazolinone analgesic, related to Analgin, affects monoamines, inhibits MAO, alters dopamine.</p>Formula:C20H22N4OColor and Shape:SolidMolecular weight:334.41
