CAS 20170-32-5: 3-(3′,5′-Di-tert-butyl-4′-hydroxyphenyl)propionic acid
Description:3-(3′,5′-Di-tert-butyl-4′-hydroxyphenyl)propionic acid, commonly referred to as a phenolic antioxidant, is characterized by its structure that includes a propionic acid moiety attached to a hydroxyphenyl group, which is further substituted with two tert-butyl groups. This compound is known for its effectiveness in preventing oxidative degradation in various materials, particularly in polymers and plastics. It exhibits high thermal stability and solubility in organic solvents, making it suitable for incorporation into various formulations. The presence of the hydroxy group contributes to its antioxidant properties, allowing it to scavenge free radicals and inhibit the oxidation process. Additionally, the bulky tert-butyl groups enhance its steric hindrance, which can improve its performance as an antioxidant by preventing the formation of reactive species. Overall, this compound is widely utilized in industrial applications to prolong the shelf life and stability of products exposed to heat and light.
Formula:C17H26O3
InChI:InChI=1S/C17H26O3/c1-16(2,3)12-9-11(7-8-14(18)19)10-13(15(12)20)17(4,5)6/h9-10,20H,7-8H2,1-6H3,(H,18,19)
InChI key:InChIKey=WPMYUUITDBHVQZ-UHFFFAOYSA-N
SMILES:O=C(O)CCC=1C=C(C(O)=C(C1)C(C)(C)C)C(C)(C)C
- Synonyms:
- 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoic acid
- 3,5-Di-tert-butyl-4-hydroxybenzenepropanoic acid
- 3,5-Di-tert-butyl-4-hydroxyhydrocinnamic acid
- 3-(3,5-Di-Tert-Butyl-4-Hydroxyphenyl)Propanoate
- 3-(3,5-Di-Tert-Butyl-4-Hydroxyphenyl)Propanoic Acid
- 3-(3,5-Di-tert-butyl-4-hydroxyphenyl)propionic acid
- 4-Hydroxy-3,5-di-tert-butylphenylpropionic acid
- Antioxidant AO
- Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-
- Dibutylhydroxyphenylpropionicacid
- See more synonyms
- Fenoksan
- Fenoxan
- Fenozan
- Fenozan acid
- Hydrocinnamic acid, 3,5-di-tert-butyl-4-hydroxy-
- Irganox 1310
- Irganox B 2
- Phenosan
- Phenoxan
- Phenoxan (antioxidant)
- Phenozan
- β-(3,5-Di-tert-butyl-4-hydroxyphenyl)propionic acid
- β-(4-Hydroxy-3,5-di-tert-butylphenyl)propanoic acid
- β-(4-Hydroxy-3,5-di-tert-butylphenyl)propionic acid
