CymitQuimica logo

CAS 20173-72-2

:

N,N,4-trimethylpyridin-2-amine

Description:
N,N,4-trimethylpyridin-2-amine, also known by its CAS number 20173-72-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three methyl groups attached to the nitrogen atom at the 4-position and an amino group at the 2-position of the pyridine ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group imparts basic properties, making it soluble in polar solvents like water and alcohols. N,N,4-trimethylpyridin-2-amine is often used in organic synthesis and as a building block in the preparation of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-donating nature of the methyl groups, which can affect its nucleophilicity and overall chemical behavior. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H12N2
InChI:InChI=1/C8H12N2/c1-7-4-5-9-8(6-7)10(2)3/h4-6H,1-3H3
InChI key:WODKXQZRQNZRDW-UHFFFAOYSA-N
SMILES:Cc1ccnc(c1)N(C)C
Found 2 products.