CAS 20175-84-2
:Isodiospyrin
Description:
Isodiospyrin, with the CAS number 20175-84-2, is a naturally occurring compound classified as a flavonoid. It is primarily derived from the Diospyros genus, particularly from the fruit of the Diospyros lotus. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Isodiospyrin is characterized by its complex polyphenolic structure, which contributes to its reactivity and interaction with various biological systems. The compound is typically found in a crystalline form and is soluble in organic solvents, but its solubility in water is limited. Its unique chemical properties and biological effects are attributed to the presence of multiple hydroxyl groups and a specific arrangement of aromatic rings, which enhance its ability to scavenge free radicals. Ongoing studies aim to further elucidate its mechanisms of action and potential therapeutic applications in medicine.
Formula:C22H14O6
InChI:InChI=1S/C22H14O6/c1-9-7-11-12(23)3-4-13(24)19(11)22(28)18(9)17-10(2)8-16(27)20-14(25)5-6-15(26)21(17)20/h3-8,27-28H,1-2H3
InChI key:InChIKey=OEEOHKZVBKYMBA-UHFFFAOYSA-N
SMILES:CC=1C(=C2C(=C(O)C1)C(=O)C=CC2=O)C=3C(O)=C4C(=CC3C)C(=O)C=CC4=O
Synonyms:- (-)-Isodiospyrin
- (1,2'-Binaphthalene)-5,5',8,8'-tetrone, 1',4-dihydroxy-2,3'-dimethyl-, (-)-
- (1R)-1′,4-Dihydroxy-2,3′-dimethyl[1,2′-binaphthalene]-5,5′,8,8′-tetrone
- [1,2′-Binaphthalene]-5,5′,8,8′-tetrone, 1′,4-dihydroxy-2,3′-dimethyl-, (1R)-
- [1,2′-Binaphthalene]-5,5′,8,8′-tetrone, 1′,4-dihydroxy-2,3′-dimethyl-, (R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[1,2'-Binaphthalene]-5,5',8,8'-tetrone, 1',4-dihydroxy-2,3'-dimethyl-, (1R)-
CAS:Formula:C22H14O6Purity:99.77%Color and Shape:SolidMolecular weight:374.3430Isodiospyrin
CAS:Isodiospyrin is a natural compound identified as a naphthoquinone derivative, which is typically derived from bacterial sources, particularly from actinomycetes. Its mode of action involves the disruption of bacterial cell processes, often targeting specific enzymes critical for cell wall synthesis or DNA replication, making it effective against certain bacterial strains. Isodiospyrin exhibits promising antibacterial properties, which have been explored in the context of combating resistant microbial infections. Its application in microbiology and pharmacology research is significant, as it provides insights into novel antimicrobial mechanisms. By studying its effects, scientists aim to develop new therapeutic agents that can address antibiotic resistance, a growing concern in medical treatment. Detailed investigations continue to unravel its potential and broaden its applicability in designing drugs for infectious disease management.Formula:C22H14O6Purity:Min. 95%Molecular weight:374.3 g/molIsodiospyrin
CAS:Isodiospyrin is a novel human DNA topoisomerase I inhibitor, it exhibits cytotoxic activity to tumor cell lines. Isodiospyrin has antibacterial activity, the minimum inhibitory concentrations (MICs) against Gram-positive bacteria ranged from 0.78 to 50 miFormula:C22H14O6Color and Shape:SolidMolecular weight:374.34




