CAS 2017555-09-6

Potassium [4-(furfurylamino-1-carbonyl)-phenyl]trifluoroborate

Description:

The chemical substance with the CAS number 2017555-09-6 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, when analyzing a chemical substance, one would consider its molecular formula, structure, physical properties (such as melting point, boiling point, and solubility), and potential applications or uses in various fields, including pharmaceuticals, materials science, or industrial processes. Additionally, safety data such as toxicity, handling precautions, and environmental impact are crucial for understanding the substance's behavior and risks. For precise characteristics, including its reactivity, stability, and specific applications, consulting specialized chemical databases or scientific literature would be necessary. If you have access to a chemical database or scientific resources, you may find more detailed and specific information regarding this compound.

Formula: C₁₂H₁₀BF₃KNO₂

InChI: InChI=1S/C12H10BF3NO2.K/c14-13(15,16)10-5-3-9(4-6-10)12(18)17-8-11-2-1-7-19-11;/h1-7H,8H2,(H,17,18);/q-1;+1

InChI key: InChIKey=BNXMQAULUCBEPA-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CO1)(=O)C2=CC=C([B-](F)(F)F)C=C2.[K+]

Synonyms:

• trifluoro-[4-(furan-2-ylmethylcarbamoyl)phenyl]boranuide
• Potassium [4-(furfurylamino-1-carbonyl)-phenyl]trifluoroborate
• potassium trifluoro(4-{[(furan-2-yl)methyl]carbamoyl}phenyl)boranuide

Potassium [4-(furfurylamino-1-carbonyl)phenyl]trifluoroborate

CAS: 2017555-09-6

Potassium [4-(furfurylamino-1-carbonyl)phenyl]trifluoroborate

Purity: ≥95%

Molecular weight: 307.12g/mol

Ref: 54-PC200142