CAS 201793-00-2
:sodium (E,3R,5S)-7-[6-[(1R)-1,2-dimethylpropyl]-4-(4-fluorophenyl)-5-(hydroxymethyl)-2-isopropyl-3-pyridyl]-3,5-dihydroxy-hept-6-enoate
Description:
The chemical substance known as sodium (E,3R,5S)-7-[6-[(1R)-1,2-dimethylpropyl]-4-(4-fluorophenyl)-5-(hydroxymethyl)-2-isopropyl-3-pyridyl]-3,5-dihydroxy-hept-6-enoate, with CAS number 201793-00-2, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a heptenoate backbone, which includes multiple hydroxyl groups, contributing to its potential solubility in polar solvents. The presence of a pyridine ring and various substituents, such as a fluorophenyl group and a dimethylpropyl moiety, suggests that this compound may exhibit significant biological activity, possibly as a pharmaceutical agent. The stereochemical configuration indicated by the (E,3R,5S) notation implies specific spatial arrangements that can influence the compound's reactivity and interaction with biological targets. Overall, this compound's unique structure may lead to interesting properties and applications in medicinal chemistry or related fields.
Formula:C27H35FNNaO5
InChI:InChI=1/C27H36FNO5.Na/c1-15(2)17(5)27-23(14-30)25(18-6-8-19(28)9-7-18)22(26(29-27)16(3)4)11-10-20(31)12-21(32)13-24(33)34;/h6-11,15-17,20-21,30-32H,12-14H2,1-5H3,(H,33,34);/q;+1/p-1/b11-10+;/t17-,20-,21-;/m1./s1
SMILES:CC(C)C(C)c1c(CO)c(c2ccc(cc2)F)c(C=CC(CC(CC(=O)O)O)O)c(C(C)C)n1.[Na]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Heptenoic acid, 7-[4-(4-fluorophenyl)-5-(hydroxymethyl)-6-[(1S)-2-hydroxy-1-methylethyl]-2-(1-methylethyl)-3-pyridinyl]-3,5-dihydroxy-, sodium salt (1:1), (3R,5S,6E)-
CAS:Formula:C25H31FNNaO6Color and Shape:SolidMolecular weight:483.5049


