CAS 201809-69-0

6-iodobenzofuran-3-one

Description:

6-Iodobenzofuran-3-one is an organic compound characterized by the presence of a benzofuran ring system with an iodine substituent at the 6-position and a carbonyl group at the 3-position. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic nature. The presence of the iodine atom can impart unique reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The carbonyl group contributes to its electrophilic character, allowing for various chemical transformations. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this compound, as iodine-containing compounds can be hazardous. Overall, 6-iodobenzofuran-3-one is a valuable compound in synthetic organic chemistry with potential applications in various fields.

Formula: C₈H₅IO₂

InChI: InChI=1/C8H5IO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3H,4H2

SMILES: c1cc2C(=O)COc2cc1I

Synonyms:

• 6-bromo-3-Benzofuranone
• 6-bromobenzofuran-3(2H)-one

6-Bromobenzofuran-3(2H)-one

CAS: 201809-69-0

Formula: C₈H₅BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 213.0281

Ref: IN-DA0027V0

6-Bromobenzo[b]furan-3(2H)-one

CAS: 201809-69-0

6-Bromobenzo[b]furan-3(2H)-one

Formula: C₈H₅BrO₂

Purity: ≥95%

Color and Shape: orange powder

Molecular weight: 213.03g/mol

Ref: 54-OR40014

6-Bromo-3(2H)-benzofuranone

CAS: 201809-69-0

Formula: C₈H₅BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.03

Ref: 10-F216893