CAS 201849-13-0

1-bromo-3-chloro-2,4-difluorobenzene

Description:

1-Bromo-3-chloro-2,4-difluorobenzene is an aromatic halogenated compound characterized by the presence of bromine, chlorine, and fluorine substituents on a benzene ring. The molecular structure features a benzene core with a bromine atom at the first position, a chlorine atom at the third position, and two fluorine atoms at the second and fourth positions. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits moderate polarity due to the electronegative halogen atoms, which can influence its solubility in various organic solvents. The presence of multiple halogens can also enhance its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound's unique substitution pattern can affect its physical properties, such as boiling and melting points, as well as its spectral characteristics, making it of interest in both industrial and research settings. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.

Formula: C₆H₂BrClF₂

InChI: InChI=1/C6H2BrClF2/c7-3-1-2-4(9)5(8)6(3)10/h1-2H

SMILES: c1cc(c(c(c1Br)F)Cl)F

Synonyms:

• Benzene, 1-bromo-3-chloro-2,4-difluoro-

Benzene, 1-bromo-3-chloro-2,4-difluoro-

CAS: 201849-13-0

Formula: C₆H₂BrClF₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 227.4339

Ref: IN-DA0027VX

3-Chloro-2,4-difluorobromobenzene

CAS: 201849-13-0

3-Chloro-2,4-difluorobromobenzene

Formula: C₆H₂BrClF₂

Purity: ≥95%

Color and Shape: clear liquid

Molecular weight: 227.43g/mol

Ref: 54-PC8716

1-Bromo-3-chloro-2,4-difluorobenzene

CAS: 201849-13-0

Formula: C₆H₂BrClF₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 227.43

Ref: 10-F043092