CAS 201852-49-5

Potassium beta-styryltrifluoroborate

Description:

Potassium beta-styryltrifluoroborate is an organoboron compound characterized by the presence of a beta-styryl group and a trifluoroborate moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its utility in organic synthesis, particularly in cross-coupling reactions, where it serves as a versatile reagent for the formation of carbon-carbon bonds. The trifluoroborate group enhances the stability and reactivity of the compound, making it an effective electrophile in various chemical transformations. Additionally, potassium beta-styryltrifluoroborate can participate in reactions with nucleophiles, facilitating the introduction of styryl groups into different substrates. Its unique properties stem from the combination of the electron-withdrawing trifluoroborate group and the conjugated system of the styryl moiety, which can influence its reactivity and interaction with other chemical species. As with many organoboron compounds, handling should be done with care, and appropriate safety measures should be observed.

Formula: C₈H₇BF₃K

InChI: InChI=1/C8H7BF3.K/c10-9(11,12)7-6-8-4-2-1-3-5-8;/h1-7H;/q-1;+1/b7-6+;

SMILES: c1ccc(cc1)C=C[B-](F)(F)F.K

Synonyms:

• beta-Styryltrifluoroboric acid potassium salt
• potassium trifluoro[(E)-2-phenylethenyl]borate(1-)

Potassium trans-β-styryltrifluoroborate, 98%

CAS: 201852-49-5

Potassium trans-beta-styryltrifluoroborate is used as a reactant for Suzuki-Miyaura cross-coupling, in enantioselective total synthesis of naseseazines A and B via regioselective Friedel-Crafts based arylative dimerization, in metal-free chlorodeboronation reactions, in preparation of aryl ketones v

Formula: C₈H₇BF₃K

Purity: 98%

Color and Shape: Crystalline powder, White

Molecular weight: 210.05

Ref: 02-L17971

Potassium (trans-​styryl)​trifluoroborate

CAS: 201852-49-5

Formula: C₈H₇BF₃K

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.0457

Ref: IN-DA0027VK

Potassium trifluoro(styryl)borate

CAS: 201852-49-5

Potassium trifluoro(styryl)borate

Purity: 95%

Molecular weight: 210.05g/mol

Ref: 54-PC1007686

Potassium trans-styryltrifluoroborate

CAS: 201852-49-5

Purity: 95%

Molecular weight: 210.02

Ref: 10-F570405