CAS 201852-50-8

α-[(1E)-2-Phenylethenyl]-4-morpholineacetic acid

Description:

α-[(1E)-2-Phenylethenyl]-4-morpholineacetic acid, with the CAS number 201852-50-8, is an organic compound characterized by its unique structure that includes a morpholine ring and a phenyl group attached to an ethenyl moiety. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the morpholine nitrogen. It is likely to be soluble in polar solvents, given the presence of the morpholine moiety, which can engage in hydrogen bonding. The compound may also demonstrate biological activity, potentially acting as a pharmaceutical agent or a biochemical probe, although specific biological properties would depend on further empirical studies. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature.

Formula: C₁₄H₁₇NO₃

InChI: InChI=1/C14H17NO3/c16-14(17)13(15-8-10-18-11-9-15)7-6-12-4-2-1-3-5-12/h1-7,13H,8-11H2,(H,16,17)/b7-6+

InChI key: InChIKey=OPCJIPPCYHIRCL-VOTSOKGWNA-N

SMILES: C(/C=C/C1=CC=CC=C1)(C(O)=O)N2CCOCC2

Synonyms:

• 4-Morpholineacetic acid, α-[(1E)-2-phenylethenyl]-
• α-[(1E)-2-Phenylethenyl]-4-morpholineacetic acid
• 4-Morpholineacetic acid, α-(2-phenylethenyl)-, (E)-

(E)-2-MORPHOLINO-4-PHENYLBUT-3-ENOIC ACID

CAS: 201852-50-8

Formula: C₁₄H₁₇NO₃

Purity: 95.0%

Molecular weight: 247.294

Ref: 10-F306445